| // Copyright 2021 The Go Authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style |
| // license that can be found in the LICENSE file. |
| |
| package noder |
| |
| import ( |
| "fmt" |
| "go/constant" |
| "internal/buildcfg" |
| "internal/pkgbits" |
| "path/filepath" |
| "strings" |
| |
| "cmd/compile/internal/base" |
| "cmd/compile/internal/deadcode" |
| "cmd/compile/internal/dwarfgen" |
| "cmd/compile/internal/inline" |
| "cmd/compile/internal/ir" |
| "cmd/compile/internal/objw" |
| "cmd/compile/internal/reflectdata" |
| "cmd/compile/internal/staticinit" |
| "cmd/compile/internal/typecheck" |
| "cmd/compile/internal/types" |
| "cmd/internal/obj" |
| "cmd/internal/objabi" |
| "cmd/internal/src" |
| ) |
| |
| // This file implements cmd/compile backend's reader for the Unified |
| // IR export data. |
| |
| // A pkgReader reads Unified IR export data. |
| type pkgReader struct { |
| pkgbits.PkgDecoder |
| |
| // Indices for encoded things; lazily populated as needed. |
| // |
| // Note: Objects (i.e., ir.Names) are lazily instantiated by |
| // populating their types.Sym.Def; see objReader below. |
| |
| posBases []*src.PosBase |
| pkgs []*types.Pkg |
| typs []*types.Type |
| |
| // offset for rewriting the given (absolute!) index into the output, |
| // but bitwise inverted so we can detect if we're missing the entry |
| // or not. |
| newindex []pkgbits.Index |
| } |
| |
| func newPkgReader(pr pkgbits.PkgDecoder) *pkgReader { |
| return &pkgReader{ |
| PkgDecoder: pr, |
| |
| posBases: make([]*src.PosBase, pr.NumElems(pkgbits.RelocPosBase)), |
| pkgs: make([]*types.Pkg, pr.NumElems(pkgbits.RelocPkg)), |
| typs: make([]*types.Type, pr.NumElems(pkgbits.RelocType)), |
| |
| newindex: make([]pkgbits.Index, pr.TotalElems()), |
| } |
| } |
| |
| // A pkgReaderIndex compactly identifies an index (and its |
| // corresponding dictionary) within a package's export data. |
| type pkgReaderIndex struct { |
| pr *pkgReader |
| idx pkgbits.Index |
| dict *readerDict |
| methodSym *types.Sym |
| |
| synthetic func(pos src.XPos, r *reader) |
| } |
| |
| func (pri pkgReaderIndex) asReader(k pkgbits.RelocKind, marker pkgbits.SyncMarker) *reader { |
| if pri.synthetic != nil { |
| return &reader{synthetic: pri.synthetic} |
| } |
| |
| r := pri.pr.newReader(k, pri.idx, marker) |
| r.dict = pri.dict |
| r.methodSym = pri.methodSym |
| return r |
| } |
| |
| func (pr *pkgReader) newReader(k pkgbits.RelocKind, idx pkgbits.Index, marker pkgbits.SyncMarker) *reader { |
| return &reader{ |
| Decoder: pr.NewDecoder(k, idx, marker), |
| p: pr, |
| } |
| } |
| |
| // A reader provides APIs for reading an individual element. |
| type reader struct { |
| pkgbits.Decoder |
| |
| p *pkgReader |
| |
| dict *readerDict |
| |
| // TODO(mdempsky): The state below is all specific to reading |
| // function bodies. It probably makes sense to split it out |
| // separately so that it doesn't take up space in every reader |
| // instance. |
| |
| curfn *ir.Func |
| locals []*ir.Name |
| closureVars []*ir.Name |
| |
| funarghack bool |
| |
| // methodSym is the name of method's name, if reading a method. |
| // It's nil if reading a normal function or closure body. |
| methodSym *types.Sym |
| |
| // dictParam is the .dict param, if any. |
| dictParam *ir.Name |
| |
| // synthetic is a callback function to construct a synthetic |
| // function body. It's used for creating the bodies of function |
| // literals used to curry arguments to shaped functions. |
| synthetic func(pos src.XPos, r *reader) |
| |
| // scopeVars is a stack tracking the number of variables declared in |
| // the current function at the moment each open scope was opened. |
| scopeVars []int |
| marker dwarfgen.ScopeMarker |
| lastCloseScopePos src.XPos |
| |
| // === details for handling inline body expansion === |
| |
| // If we're reading in a function body because of inlining, this is |
| // the call that we're inlining for. |
| inlCaller *ir.Func |
| inlCall *ir.CallExpr |
| inlFunc *ir.Func |
| inlTreeIndex int |
| inlPosBases map[*src.PosBase]*src.PosBase |
| |
| // suppressInlPos tracks whether position base rewriting for |
| // inlining should be suppressed. See funcLit. |
| suppressInlPos int |
| |
| delayResults bool |
| |
| // Label to return to. |
| retlabel *types.Sym |
| |
| // inlvars is the list of variables that the inlinee's arguments are |
| // assigned to, one for each receiver and normal parameter, in order. |
| inlvars ir.Nodes |
| |
| // retvars is the list of variables that the inlinee's results are |
| // assigned to, one for each result parameter, in order. |
| retvars ir.Nodes |
| } |
| |
| // A readerDict represents an instantiated "compile-time dictionary," |
| // used for resolving any derived types needed for instantiating a |
| // generic object. |
| // |
| // A compile-time dictionary can either be "shaped" or "non-shaped." |
| // Shaped compile-time dictionaries are only used for instantiating |
| // shaped type definitions and function bodies, while non-shaped |
| // compile-time dictionaries are used for instantiating runtime |
| // dictionaries. |
| type readerDict struct { |
| shaped bool // whether this is a shaped dictionary |
| |
| // baseSym is the symbol for the object this dictionary belongs to. |
| // If the object is an instantiated function or defined type, then |
| // baseSym is the mangled symbol, including any type arguments. |
| baseSym *types.Sym |
| |
| // For non-shaped dictionaries, shapedObj is a reference to the |
| // corresponding shaped object (always a function or defined type). |
| shapedObj *ir.Name |
| |
| // targs holds the implicit and explicit type arguments in use for |
| // reading the current object. For example: |
| // |
| // func F[T any]() { |
| // type X[U any] struct { t T; u U } |
| // var _ X[string] |
| // } |
| // |
| // var _ = F[int] |
| // |
| // While instantiating F[int], we need to in turn instantiate |
| // X[string]. [int] and [string] are explicit type arguments for F |
| // and X, respectively; but [int] is also the implicit type |
| // arguments for X. |
| // |
| // (As an analogy to function literals, explicits are the function |
| // literal's formal parameters, while implicits are variables |
| // captured by the function literal.) |
| targs []*types.Type |
| |
| // implicits counts how many of types within targs are implicit type |
| // arguments; the rest are explicit. |
| implicits int |
| |
| derived []derivedInfo // reloc index of the derived type's descriptor |
| derivedTypes []*types.Type // slice of previously computed derived types |
| |
| // These slices correspond to entries in the runtime dictionary. |
| typeParamMethodExprs []readerMethodExprInfo |
| subdicts []objInfo |
| rtypes []typeInfo |
| itabs []itabInfo |
| } |
| |
| type readerMethodExprInfo struct { |
| typeParamIdx int |
| method *types.Sym |
| } |
| |
| func setType(n ir.Node, typ *types.Type) { |
| n.SetType(typ) |
| n.SetTypecheck(1) |
| } |
| |
| func setValue(name *ir.Name, val constant.Value) { |
| name.SetVal(val) |
| name.Defn = nil |
| } |
| |
| // @@@ Positions |
| |
| // pos reads a position from the bitstream. |
| func (r *reader) pos() src.XPos { |
| return base.Ctxt.PosTable.XPos(r.pos0()) |
| } |
| |
| // origPos reads a position from the bitstream, and returns both the |
| // original raw position and an inlining-adjusted position. |
| func (r *reader) origPos() (origPos, inlPos src.XPos) { |
| r.suppressInlPos++ |
| origPos = r.pos() |
| r.suppressInlPos-- |
| inlPos = r.inlPos(origPos) |
| return |
| } |
| |
| func (r *reader) pos0() src.Pos { |
| r.Sync(pkgbits.SyncPos) |
| if !r.Bool() { |
| return src.NoPos |
| } |
| |
| posBase := r.posBase() |
| line := r.Uint() |
| col := r.Uint() |
| return src.MakePos(posBase, line, col) |
| } |
| |
| // posBase reads a position base from the bitstream. |
| func (r *reader) posBase() *src.PosBase { |
| return r.inlPosBase(r.p.posBaseIdx(r.Reloc(pkgbits.RelocPosBase))) |
| } |
| |
| // posBaseIdx returns the specified position base, reading it first if |
| // needed. |
| func (pr *pkgReader) posBaseIdx(idx pkgbits.Index) *src.PosBase { |
| if b := pr.posBases[idx]; b != nil { |
| return b |
| } |
| |
| r := pr.newReader(pkgbits.RelocPosBase, idx, pkgbits.SyncPosBase) |
| var b *src.PosBase |
| |
| absFilename := r.String() |
| filename := absFilename |
| |
| // For build artifact stability, the export data format only |
| // contains the "absolute" filename as returned by objabi.AbsFile. |
| // However, some tests (e.g., test/run.go's asmcheck tests) expect |
| // to see the full, original filename printed out. Re-expanding |
| // "$GOROOT" to buildcfg.GOROOT is a close-enough approximation to |
| // satisfy this. |
| // |
| // The export data format only ever uses slash paths |
| // (for cross-operating-system reproducible builds), |
| // but error messages need to use native paths (backslash on Windows) |
| // as if they had been specified on the command line. |
| // (The go command always passes native paths to the compiler.) |
| const dollarGOROOT = "$GOROOT" |
| if buildcfg.GOROOT != "" && strings.HasPrefix(filename, dollarGOROOT) { |
| filename = filepath.FromSlash(buildcfg.GOROOT + filename[len(dollarGOROOT):]) |
| } |
| |
| if r.Bool() { |
| b = src.NewFileBase(filename, absFilename) |
| } else { |
| pos := r.pos0() |
| line := r.Uint() |
| col := r.Uint() |
| b = src.NewLinePragmaBase(pos, filename, absFilename, line, col) |
| } |
| |
| pr.posBases[idx] = b |
| return b |
| } |
| |
| // inlPosBase returns the inlining-adjusted src.PosBase corresponding |
| // to oldBase, which must be a non-inlined position. When not |
| // inlining, this is just oldBase. |
| func (r *reader) inlPosBase(oldBase *src.PosBase) *src.PosBase { |
| if index := oldBase.InliningIndex(); index >= 0 { |
| base.Fatalf("oldBase %v already has inlining index %v", oldBase, index) |
| } |
| |
| if r.inlCall == nil || r.suppressInlPos != 0 { |
| return oldBase |
| } |
| |
| if newBase, ok := r.inlPosBases[oldBase]; ok { |
| return newBase |
| } |
| |
| newBase := src.NewInliningBase(oldBase, r.inlTreeIndex) |
| r.inlPosBases[oldBase] = newBase |
| return newBase |
| } |
| |
| // inlPos returns the inlining-adjusted src.XPos corresponding to |
| // xpos, which must be a non-inlined position. When not inlining, this |
| // is just xpos. |
| func (r *reader) inlPos(xpos src.XPos) src.XPos { |
| pos := base.Ctxt.PosTable.Pos(xpos) |
| pos.SetBase(r.inlPosBase(pos.Base())) |
| return base.Ctxt.PosTable.XPos(pos) |
| } |
| |
| // @@@ Packages |
| |
| // pkg reads a package reference from the bitstream. |
| func (r *reader) pkg() *types.Pkg { |
| r.Sync(pkgbits.SyncPkg) |
| return r.p.pkgIdx(r.Reloc(pkgbits.RelocPkg)) |
| } |
| |
| // pkgIdx returns the specified package from the export data, reading |
| // it first if needed. |
| func (pr *pkgReader) pkgIdx(idx pkgbits.Index) *types.Pkg { |
| if pkg := pr.pkgs[idx]; pkg != nil { |
| return pkg |
| } |
| |
| pkg := pr.newReader(pkgbits.RelocPkg, idx, pkgbits.SyncPkgDef).doPkg() |
| pr.pkgs[idx] = pkg |
| return pkg |
| } |
| |
| // doPkg reads a package definition from the bitstream. |
| func (r *reader) doPkg() *types.Pkg { |
| path := r.String() |
| switch path { |
| case "": |
| path = r.p.PkgPath() |
| case "builtin": |
| return types.BuiltinPkg |
| case "unsafe": |
| return types.UnsafePkg |
| } |
| |
| name := r.String() |
| |
| pkg := types.NewPkg(path, "") |
| |
| if pkg.Name == "" { |
| pkg.Name = name |
| } else { |
| base.Assertf(pkg.Name == name, "package %q has name %q, but want %q", pkg.Path, pkg.Name, name) |
| } |
| |
| return pkg |
| } |
| |
| // @@@ Types |
| |
| func (r *reader) typ() *types.Type { |
| return r.typWrapped(true) |
| } |
| |
| // typWrapped is like typ, but allows suppressing generation of |
| // unnecessary wrappers as a compile-time optimization. |
| func (r *reader) typWrapped(wrapped bool) *types.Type { |
| return r.p.typIdx(r.typInfo(), r.dict, wrapped) |
| } |
| |
| func (r *reader) typInfo() typeInfo { |
| r.Sync(pkgbits.SyncType) |
| if r.Bool() { |
| return typeInfo{idx: pkgbits.Index(r.Len()), derived: true} |
| } |
| return typeInfo{idx: r.Reloc(pkgbits.RelocType), derived: false} |
| } |
| |
| // typListIdx returns a list of the specified types, resolving derived |
| // types within the given dictionary. |
| func (pr *pkgReader) typListIdx(infos []typeInfo, dict *readerDict) []*types.Type { |
| typs := make([]*types.Type, len(infos)) |
| for i, info := range infos { |
| typs[i] = pr.typIdx(info, dict, true) |
| } |
| return typs |
| } |
| |
| // typIdx returns the specified type. If info specifies a derived |
| // type, it's resolved within the given dictionary. If wrapped is |
| // true, then method wrappers will be generated, if appropriate. |
| func (pr *pkgReader) typIdx(info typeInfo, dict *readerDict, wrapped bool) *types.Type { |
| idx := info.idx |
| var where **types.Type |
| if info.derived { |
| where = &dict.derivedTypes[idx] |
| idx = dict.derived[idx].idx |
| } else { |
| where = &pr.typs[idx] |
| } |
| |
| if typ := *where; typ != nil { |
| return typ |
| } |
| |
| r := pr.newReader(pkgbits.RelocType, idx, pkgbits.SyncTypeIdx) |
| r.dict = dict |
| |
| typ := r.doTyp() |
| assert(typ != nil) |
| |
| // For recursive type declarations involving interfaces and aliases, |
| // above r.doTyp() call may have already set pr.typs[idx], so just |
| // double check and return the type. |
| // |
| // Example: |
| // |
| // type F = func(I) |
| // |
| // type I interface { |
| // m(F) |
| // } |
| // |
| // The writer writes data types in following index order: |
| // |
| // 0: func(I) |
| // 1: I |
| // 2: interface{m(func(I))} |
| // |
| // The reader resolves it in following index order: |
| // |
| // 0 -> 1 -> 2 -> 0 -> 1 |
| // |
| // and can divide in logically 2 steps: |
| // |
| // - 0 -> 1 : first time the reader reach type I, |
| // it creates new named type with symbol I. |
| // |
| // - 2 -> 0 -> 1: the reader ends up reaching symbol I again, |
| // now the symbol I was setup in above step, so |
| // the reader just return the named type. |
| // |
| // Now, the functions called return, the pr.typs looks like below: |
| // |
| // - 0 -> 1 -> 2 -> 0 : [<T> I <T>] |
| // - 0 -> 1 -> 2 : [func(I) I <T>] |
| // - 0 -> 1 : [func(I) I interface { "".m(func("".I)) }] |
| // |
| // The idx 1, corresponding with type I was resolved successfully |
| // after r.doTyp() call. |
| |
| if prev := *where; prev != nil { |
| return prev |
| } |
| |
| if wrapped { |
| // Only cache if we're adding wrappers, so that other callers that |
| // find a cached type know it was wrapped. |
| *where = typ |
| |
| r.needWrapper(typ) |
| } |
| |
| if !typ.IsUntyped() { |
| types.CheckSize(typ) |
| } |
| |
| return typ |
| } |
| |
| func (r *reader) doTyp() *types.Type { |
| switch tag := pkgbits.CodeType(r.Code(pkgbits.SyncType)); tag { |
| default: |
| panic(fmt.Sprintf("unexpected type: %v", tag)) |
| |
| case pkgbits.TypeBasic: |
| return *basics[r.Len()] |
| |
| case pkgbits.TypeNamed: |
| obj := r.obj() |
| assert(obj.Op() == ir.OTYPE) |
| return obj.Type() |
| |
| case pkgbits.TypeTypeParam: |
| return r.dict.targs[r.Len()] |
| |
| case pkgbits.TypeArray: |
| len := int64(r.Uint64()) |
| return types.NewArray(r.typ(), len) |
| case pkgbits.TypeChan: |
| dir := dirs[r.Len()] |
| return types.NewChan(r.typ(), dir) |
| case pkgbits.TypeMap: |
| return types.NewMap(r.typ(), r.typ()) |
| case pkgbits.TypePointer: |
| return types.NewPtr(r.typ()) |
| case pkgbits.TypeSignature: |
| return r.signature(nil) |
| case pkgbits.TypeSlice: |
| return types.NewSlice(r.typ()) |
| case pkgbits.TypeStruct: |
| return r.structType() |
| case pkgbits.TypeInterface: |
| return r.interfaceType() |
| case pkgbits.TypeUnion: |
| return r.unionType() |
| } |
| } |
| |
| func (r *reader) unionType() *types.Type { |
| // In the types1 universe, we only need to handle value types. |
| // Impure interfaces (i.e., interfaces with non-trivial type sets |
| // like "int | string") can only appear as type parameter bounds, |
| // and this is enforced by the types2 type checker. |
| // |
| // However, type unions can still appear in pure interfaces if the |
| // type union is equivalent to "any". E.g., typeparam/issue52124.go |
| // declares variables with the type "interface { any | int }". |
| // |
| // To avoid needing to represent type unions in types1 (since we |
| // don't have any uses for that today anyway), we simply fold them |
| // to "any". |
| |
| // TODO(mdempsky): Restore consistency check to make sure folding to |
| // "any" is safe. This is unfortunately tricky, because a pure |
| // interface can reference impure interfaces too, including |
| // cyclically (#60117). |
| if false { |
| pure := false |
| for i, n := 0, r.Len(); i < n; i++ { |
| _ = r.Bool() // tilde |
| term := r.typ() |
| if term.IsEmptyInterface() { |
| pure = true |
| } |
| } |
| if !pure { |
| base.Fatalf("impure type set used in value type") |
| } |
| } |
| |
| return types.Types[types.TINTER] |
| } |
| |
| func (r *reader) interfaceType() *types.Type { |
| nmethods, nembeddeds := r.Len(), r.Len() |
| implicit := nmethods == 0 && nembeddeds == 1 && r.Bool() |
| assert(!implicit) // implicit interfaces only appear in constraints |
| |
| fields := make([]*types.Field, nmethods+nembeddeds) |
| methods, embeddeds := fields[:nmethods], fields[nmethods:] |
| |
| for i := range methods { |
| pos := r.pos() |
| _, sym := r.selector() |
| mtyp := r.signature(types.FakeRecv()) |
| methods[i] = types.NewField(pos, sym, mtyp) |
| } |
| for i := range embeddeds { |
| embeddeds[i] = types.NewField(src.NoXPos, nil, r.typ()) |
| } |
| |
| if len(fields) == 0 { |
| return types.Types[types.TINTER] // empty interface |
| } |
| return types.NewInterface(fields) |
| } |
| |
| func (r *reader) structType() *types.Type { |
| fields := make([]*types.Field, r.Len()) |
| for i := range fields { |
| pos := r.pos() |
| _, sym := r.selector() |
| ftyp := r.typ() |
| tag := r.String() |
| embedded := r.Bool() |
| |
| f := types.NewField(pos, sym, ftyp) |
| f.Note = tag |
| if embedded { |
| f.Embedded = 1 |
| } |
| fields[i] = f |
| } |
| return types.NewStruct(fields) |
| } |
| |
| func (r *reader) signature(recv *types.Field) *types.Type { |
| r.Sync(pkgbits.SyncSignature) |
| |
| params := r.params() |
| results := r.params() |
| if r.Bool() { // variadic |
| params[len(params)-1].SetIsDDD(true) |
| } |
| |
| return types.NewSignature(recv, params, results) |
| } |
| |
| func (r *reader) params() []*types.Field { |
| r.Sync(pkgbits.SyncParams) |
| fields := make([]*types.Field, r.Len()) |
| for i := range fields { |
| _, fields[i] = r.param() |
| } |
| return fields |
| } |
| |
| func (r *reader) param() (*types.Pkg, *types.Field) { |
| r.Sync(pkgbits.SyncParam) |
| |
| pos := r.pos() |
| pkg, sym := r.localIdent() |
| typ := r.typ() |
| |
| return pkg, types.NewField(pos, sym, typ) |
| } |
| |
| // @@@ Objects |
| |
| // objReader maps qualified identifiers (represented as *types.Sym) to |
| // a pkgReader and corresponding index that can be used for reading |
| // that object's definition. |
| var objReader = map[*types.Sym]pkgReaderIndex{} |
| |
| // obj reads an instantiated object reference from the bitstream. |
| func (r *reader) obj() ir.Node { |
| return r.p.objInstIdx(r.objInfo(), r.dict, false) |
| } |
| |
| // objInfo reads an instantiated object reference from the bitstream |
| // and returns the encoded reference to it, without instantiating it. |
| func (r *reader) objInfo() objInfo { |
| r.Sync(pkgbits.SyncObject) |
| assert(!r.Bool()) // TODO(mdempsky): Remove; was derived func inst. |
| idx := r.Reloc(pkgbits.RelocObj) |
| |
| explicits := make([]typeInfo, r.Len()) |
| for i := range explicits { |
| explicits[i] = r.typInfo() |
| } |
| |
| return objInfo{idx, explicits} |
| } |
| |
| // objInstIdx returns the encoded, instantiated object. If shaped is |
| // true, then the shaped variant of the object is returned instead. |
| func (pr *pkgReader) objInstIdx(info objInfo, dict *readerDict, shaped bool) ir.Node { |
| explicits := pr.typListIdx(info.explicits, dict) |
| |
| var implicits []*types.Type |
| if dict != nil { |
| implicits = dict.targs |
| } |
| |
| return pr.objIdx(info.idx, implicits, explicits, shaped) |
| } |
| |
| // objIdx returns the specified object, instantiated with the given |
| // type arguments, if any. If shaped is true, then the shaped variant |
| // of the object is returned instead. |
| func (pr *pkgReader) objIdx(idx pkgbits.Index, implicits, explicits []*types.Type, shaped bool) ir.Node { |
| rname := pr.newReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) |
| _, sym := rname.qualifiedIdent() |
| tag := pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) |
| |
| if tag == pkgbits.ObjStub { |
| assert(!sym.IsBlank()) |
| switch sym.Pkg { |
| case types.BuiltinPkg, types.UnsafePkg: |
| return sym.Def.(ir.Node) |
| } |
| if pri, ok := objReader[sym]; ok { |
| return pri.pr.objIdx(pri.idx, nil, explicits, shaped) |
| } |
| base.Fatalf("unresolved stub: %v", sym) |
| } |
| |
| dict := pr.objDictIdx(sym, idx, implicits, explicits, shaped) |
| |
| sym = dict.baseSym |
| if !sym.IsBlank() && sym.Def != nil { |
| return sym.Def.(*ir.Name) |
| } |
| |
| r := pr.newReader(pkgbits.RelocObj, idx, pkgbits.SyncObject1) |
| rext := pr.newReader(pkgbits.RelocObjExt, idx, pkgbits.SyncObject1) |
| |
| r.dict = dict |
| rext.dict = dict |
| |
| do := func(op ir.Op, hasTParams bool) *ir.Name { |
| pos := r.pos() |
| setBasePos(pos) |
| if hasTParams { |
| r.typeParamNames() |
| } |
| |
| name := ir.NewDeclNameAt(pos, op, sym) |
| name.Class = ir.PEXTERN // may be overridden later |
| if !sym.IsBlank() { |
| if sym.Def != nil { |
| base.FatalfAt(name.Pos(), "already have a definition for %v", name) |
| } |
| assert(sym.Def == nil) |
| sym.Def = name |
| } |
| return name |
| } |
| |
| switch tag { |
| default: |
| panic("unexpected object") |
| |
| case pkgbits.ObjAlias: |
| name := do(ir.OTYPE, false) |
| setType(name, r.typ()) |
| name.SetAlias(true) |
| return name |
| |
| case pkgbits.ObjConst: |
| name := do(ir.OLITERAL, false) |
| typ := r.typ() |
| val := FixValue(typ, r.Value()) |
| setType(name, typ) |
| setValue(name, val) |
| return name |
| |
| case pkgbits.ObjFunc: |
| if sym.Name == "init" { |
| sym = Renameinit() |
| } |
| name := do(ir.ONAME, true) |
| setType(name, r.signature(nil)) |
| |
| name.Func = ir.NewFunc(r.pos()) |
| name.Func.Nname = name |
| |
| if r.hasTypeParams() { |
| name.Func.SetDupok(true) |
| if r.dict.shaped { |
| setType(name, shapeSig(name.Func, r.dict)) |
| } else { |
| todoDicts = append(todoDicts, func() { |
| r.dict.shapedObj = pr.objIdx(idx, implicits, explicits, true).(*ir.Name) |
| }) |
| } |
| } |
| |
| rext.funcExt(name, nil) |
| return name |
| |
| case pkgbits.ObjType: |
| name := do(ir.OTYPE, true) |
| typ := types.NewNamed(name) |
| setType(name, typ) |
| if r.hasTypeParams() && r.dict.shaped { |
| typ.SetHasShape(true) |
| } |
| |
| // Important: We need to do this before SetUnderlying. |
| rext.typeExt(name) |
| |
| // We need to defer CheckSize until we've called SetUnderlying to |
| // handle recursive types. |
| types.DeferCheckSize() |
| typ.SetUnderlying(r.typWrapped(false)) |
| types.ResumeCheckSize() |
| |
| if r.hasTypeParams() && !r.dict.shaped { |
| todoDicts = append(todoDicts, func() { |
| r.dict.shapedObj = pr.objIdx(idx, implicits, explicits, true).(*ir.Name) |
| }) |
| } |
| |
| methods := make([]*types.Field, r.Len()) |
| for i := range methods { |
| methods[i] = r.method(rext) |
| } |
| if len(methods) != 0 { |
| typ.Methods().Set(methods) |
| } |
| |
| if !r.dict.shaped { |
| r.needWrapper(typ) |
| } |
| |
| return name |
| |
| case pkgbits.ObjVar: |
| name := do(ir.ONAME, false) |
| setType(name, r.typ()) |
| rext.varExt(name) |
| return name |
| } |
| } |
| |
| func (dict *readerDict) mangle(sym *types.Sym) *types.Sym { |
| if !dict.hasTypeParams() { |
| return sym |
| } |
| |
| // If sym is a locally defined generic type, we need the suffix to |
| // stay at the end after mangling so that types/fmt.go can strip it |
| // out again when writing the type's runtime descriptor (#54456). |
| base, suffix := types.SplitVargenSuffix(sym.Name) |
| |
| var buf strings.Builder |
| buf.WriteString(base) |
| buf.WriteByte('[') |
| for i, targ := range dict.targs { |
| if i > 0 { |
| if i == dict.implicits { |
| buf.WriteByte(';') |
| } else { |
| buf.WriteByte(',') |
| } |
| } |
| buf.WriteString(targ.LinkString()) |
| } |
| buf.WriteByte(']') |
| buf.WriteString(suffix) |
| return sym.Pkg.Lookup(buf.String()) |
| } |
| |
| // shapify returns the shape type for targ. |
| // |
| // If basic is true, then the type argument is used to instantiate a |
| // type parameter whose constraint is a basic interface. |
| func shapify(targ *types.Type, basic bool) *types.Type { |
| if targ.Kind() == types.TFORW { |
| if targ.IsFullyInstantiated() { |
| // For recursive instantiated type argument, it may still be a TFORW |
| // when shapifying happens. If we don't have targ's underlying type, |
| // shapify won't work. The worst case is we end up not reusing code |
| // optimally in some tricky cases. |
| if base.Debug.Shapify != 0 { |
| base.Warn("skipping shaping of recursive type %v", targ) |
| } |
| if targ.HasShape() { |
| return targ |
| } |
| } else { |
| base.Fatalf("%v is missing its underlying type", targ) |
| } |
| } |
| |
| // When a pointer type is used to instantiate a type parameter |
| // constrained by a basic interface, we know the pointer's element |
| // type can't matter to the generated code. In this case, we can use |
| // an arbitrary pointer type as the shape type. (To match the |
| // non-unified frontend, we use `*byte`.) |
| // |
| // Otherwise, we simply use the type's underlying type as its shape. |
| // |
| // TODO(mdempsky): It should be possible to do much more aggressive |
| // shaping still; e.g., collapsing all pointer-shaped types into a |
| // common type, collapsing scalars of the same size/alignment into a |
| // common type, recursively shaping the element types of composite |
| // types, and discarding struct field names and tags. However, we'll |
| // need to start tracking how type parameters are actually used to |
| // implement some of these optimizations. |
| under := targ.Underlying() |
| if basic && targ.IsPtr() && !targ.Elem().NotInHeap() { |
| under = types.NewPtr(types.Types[types.TUINT8]) |
| } |
| |
| sym := types.ShapePkg.Lookup(under.LinkString()) |
| if sym.Def == nil { |
| name := ir.NewDeclNameAt(under.Pos(), ir.OTYPE, sym) |
| typ := types.NewNamed(name) |
| typ.SetUnderlying(under) |
| sym.Def = typed(typ, name) |
| } |
| res := sym.Def.Type() |
| assert(res.IsShape()) |
| assert(res.HasShape()) |
| return res |
| } |
| |
| // objDictIdx reads and returns the specified object dictionary. |
| func (pr *pkgReader) objDictIdx(sym *types.Sym, idx pkgbits.Index, implicits, explicits []*types.Type, shaped bool) *readerDict { |
| r := pr.newReader(pkgbits.RelocObjDict, idx, pkgbits.SyncObject1) |
| |
| dict := readerDict{ |
| shaped: shaped, |
| } |
| |
| nimplicits := r.Len() |
| nexplicits := r.Len() |
| |
| if nimplicits > len(implicits) || nexplicits != len(explicits) { |
| base.Fatalf("%v has %v+%v params, but instantiated with %v+%v args", sym, nimplicits, nexplicits, len(implicits), len(explicits)) |
| } |
| |
| dict.targs = append(implicits[:nimplicits:nimplicits], explicits...) |
| dict.implicits = nimplicits |
| |
| // Within the compiler, we can just skip over the type parameters. |
| for range dict.targs[dict.implicits:] { |
| // Skip past bounds without actually evaluating them. |
| r.typInfo() |
| } |
| |
| dict.derived = make([]derivedInfo, r.Len()) |
| dict.derivedTypes = make([]*types.Type, len(dict.derived)) |
| for i := range dict.derived { |
| dict.derived[i] = derivedInfo{r.Reloc(pkgbits.RelocType), r.Bool()} |
| } |
| |
| // Runtime dictionary information; private to the compiler. |
| |
| // If any type argument is already shaped, then we're constructing a |
| // shaped object, even if not explicitly requested (i.e., calling |
| // objIdx with shaped==true). This can happen with instantiating |
| // types that are referenced within a function body. |
| for _, targ := range dict.targs { |
| if targ.HasShape() { |
| dict.shaped = true |
| break |
| } |
| } |
| |
| // And if we're constructing a shaped object, then shapify all type |
| // arguments. |
| for i, targ := range dict.targs { |
| basic := r.Bool() |
| if dict.shaped { |
| dict.targs[i] = shapify(targ, basic) |
| } |
| } |
| |
| dict.baseSym = dict.mangle(sym) |
| |
| dict.typeParamMethodExprs = make([]readerMethodExprInfo, r.Len()) |
| for i := range dict.typeParamMethodExprs { |
| typeParamIdx := r.Len() |
| _, method := r.selector() |
| |
| dict.typeParamMethodExprs[i] = readerMethodExprInfo{typeParamIdx, method} |
| } |
| |
| dict.subdicts = make([]objInfo, r.Len()) |
| for i := range dict.subdicts { |
| dict.subdicts[i] = r.objInfo() |
| } |
| |
| dict.rtypes = make([]typeInfo, r.Len()) |
| for i := range dict.rtypes { |
| dict.rtypes[i] = r.typInfo() |
| } |
| |
| dict.itabs = make([]itabInfo, r.Len()) |
| for i := range dict.itabs { |
| dict.itabs[i] = itabInfo{typ: r.typInfo(), iface: r.typInfo()} |
| } |
| |
| return &dict |
| } |
| |
| func (r *reader) typeParamNames() { |
| r.Sync(pkgbits.SyncTypeParamNames) |
| |
| for range r.dict.targs[r.dict.implicits:] { |
| r.pos() |
| r.localIdent() |
| } |
| } |
| |
| func (r *reader) method(rext *reader) *types.Field { |
| r.Sync(pkgbits.SyncMethod) |
| pos := r.pos() |
| _, sym := r.selector() |
| r.typeParamNames() |
| _, recv := r.param() |
| typ := r.signature(recv) |
| |
| name := ir.NewNameAt(pos, ir.MethodSym(recv.Type, sym)) |
| setType(name, typ) |
| |
| name.Func = ir.NewFunc(r.pos()) |
| name.Func.Nname = name |
| |
| if r.hasTypeParams() { |
| name.Func.SetDupok(true) |
| if r.dict.shaped { |
| typ = shapeSig(name.Func, r.dict) |
| setType(name, typ) |
| } |
| } |
| |
| rext.funcExt(name, sym) |
| |
| meth := types.NewField(name.Func.Pos(), sym, typ) |
| meth.Nname = name |
| meth.SetNointerface(name.Func.Pragma&ir.Nointerface != 0) |
| |
| return meth |
| } |
| |
| func (r *reader) qualifiedIdent() (pkg *types.Pkg, sym *types.Sym) { |
| r.Sync(pkgbits.SyncSym) |
| pkg = r.pkg() |
| if name := r.String(); name != "" { |
| sym = pkg.Lookup(name) |
| } |
| return |
| } |
| |
| func (r *reader) localIdent() (pkg *types.Pkg, sym *types.Sym) { |
| r.Sync(pkgbits.SyncLocalIdent) |
| pkg = r.pkg() |
| if name := r.String(); name != "" { |
| sym = pkg.Lookup(name) |
| } |
| return |
| } |
| |
| func (r *reader) selector() (origPkg *types.Pkg, sym *types.Sym) { |
| r.Sync(pkgbits.SyncSelector) |
| origPkg = r.pkg() |
| name := r.String() |
| pkg := origPkg |
| if types.IsExported(name) { |
| pkg = types.LocalPkg |
| } |
| sym = pkg.Lookup(name) |
| return |
| } |
| |
| func (r *reader) hasTypeParams() bool { |
| return r.dict.hasTypeParams() |
| } |
| |
| func (dict *readerDict) hasTypeParams() bool { |
| return dict != nil && len(dict.targs) != 0 |
| } |
| |
| // @@@ Compiler extensions |
| |
| func (r *reader) funcExt(name *ir.Name, method *types.Sym) { |
| r.Sync(pkgbits.SyncFuncExt) |
| |
| name.Class = 0 // so MarkFunc doesn't complain |
| ir.MarkFunc(name) |
| |
| fn := name.Func |
| |
| // XXX: Workaround because linker doesn't know how to copy Pos. |
| if !fn.Pos().IsKnown() { |
| fn.SetPos(name.Pos()) |
| } |
| |
| // Normally, we only compile local functions, which saves redundant compilation work. |
| // n.Defn is not nil for local functions, and is nil for imported function. But for |
| // generic functions, we might have an instantiation that no other package has seen before. |
| // So we need to be conservative and compile it again. |
| // |
| // That's why name.Defn is set here, so ir.VisitFuncsBottomUp can analyze function. |
| // TODO(mdempsky,cuonglm): find a cleaner way to handle this. |
| if name.Sym().Pkg == types.LocalPkg || r.hasTypeParams() { |
| name.Defn = fn |
| } |
| |
| fn.Pragma = r.pragmaFlag() |
| r.linkname(name) |
| |
| if buildcfg.GOARCH == "wasm" { |
| xmod := r.String() |
| xname := r.String() |
| |
| if xmod != "" && xname != "" { |
| fn.WasmImport = &ir.WasmImport{ |
| Module: xmod, |
| Name: xname, |
| } |
| } |
| } |
| |
| typecheck.Func(fn) |
| |
| if r.Bool() { |
| assert(name.Defn == nil) |
| |
| fn.ABI = obj.ABI(r.Uint64()) |
| |
| // Escape analysis. |
| for _, fs := range &types.RecvsParams { |
| for _, f := range fs(name.Type()).FieldSlice() { |
| f.Note = r.String() |
| } |
| } |
| |
| if r.Bool() { |
| fn.Inl = &ir.Inline{ |
| Cost: int32(r.Len()), |
| CanDelayResults: r.Bool(), |
| } |
| } |
| } else { |
| r.addBody(name.Func, method) |
| } |
| r.Sync(pkgbits.SyncEOF) |
| } |
| |
| func (r *reader) typeExt(name *ir.Name) { |
| r.Sync(pkgbits.SyncTypeExt) |
| |
| typ := name.Type() |
| |
| if r.hasTypeParams() { |
| // Set "RParams" (really type arguments here, not parameters) so |
| // this type is treated as "fully instantiated". This ensures the |
| // type descriptor is written out as DUPOK and method wrappers are |
| // generated even for imported types. |
| var targs []*types.Type |
| targs = append(targs, r.dict.targs...) |
| typ.SetRParams(targs) |
| } |
| |
| name.SetPragma(r.pragmaFlag()) |
| |
| typecheck.SetBaseTypeIndex(typ, r.Int64(), r.Int64()) |
| } |
| |
| func (r *reader) varExt(name *ir.Name) { |
| r.Sync(pkgbits.SyncVarExt) |
| r.linkname(name) |
| } |
| |
| func (r *reader) linkname(name *ir.Name) { |
| assert(name.Op() == ir.ONAME) |
| r.Sync(pkgbits.SyncLinkname) |
| |
| if idx := r.Int64(); idx >= 0 { |
| lsym := name.Linksym() |
| lsym.SymIdx = int32(idx) |
| lsym.Set(obj.AttrIndexed, true) |
| } else { |
| name.Sym().Linkname = r.String() |
| } |
| } |
| |
| func (r *reader) pragmaFlag() ir.PragmaFlag { |
| r.Sync(pkgbits.SyncPragma) |
| return ir.PragmaFlag(r.Int()) |
| } |
| |
| // @@@ Function bodies |
| |
| // bodyReader tracks where the serialized IR for a local or imported, |
| // generic function's body can be found. |
| var bodyReader = map[*ir.Func]pkgReaderIndex{} |
| |
| // importBodyReader tracks where the serialized IR for an imported, |
| // static (i.e., non-generic) function body can be read. |
| var importBodyReader = map[*types.Sym]pkgReaderIndex{} |
| |
| // bodyReaderFor returns the pkgReaderIndex for reading fn's |
| // serialized IR, and whether one was found. |
| func bodyReaderFor(fn *ir.Func) (pri pkgReaderIndex, ok bool) { |
| if fn.Nname.Defn != nil { |
| pri, ok = bodyReader[fn] |
| base.AssertfAt(ok, base.Pos, "must have bodyReader for %v", fn) // must always be available |
| } else { |
| pri, ok = importBodyReader[fn.Sym()] |
| } |
| return |
| } |
| |
| // todoDicts holds the list of dictionaries that still need their |
| // runtime dictionary objects constructed. |
| var todoDicts []func() |
| |
| // todoBodies holds the list of function bodies that still need to be |
| // constructed. |
| var todoBodies []*ir.Func |
| |
| // addBody reads a function body reference from the element bitstream, |
| // and associates it with fn. |
| func (r *reader) addBody(fn *ir.Func, method *types.Sym) { |
| // addBody should only be called for local functions or imported |
| // generic functions; see comment in funcExt. |
| assert(fn.Nname.Defn != nil) |
| |
| idx := r.Reloc(pkgbits.RelocBody) |
| |
| pri := pkgReaderIndex{r.p, idx, r.dict, method, nil} |
| bodyReader[fn] = pri |
| |
| if r.curfn == nil { |
| todoBodies = append(todoBodies, fn) |
| return |
| } |
| |
| pri.funcBody(fn) |
| } |
| |
| func (pri pkgReaderIndex) funcBody(fn *ir.Func) { |
| r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) |
| r.funcBody(fn) |
| } |
| |
| // funcBody reads a function body definition from the element |
| // bitstream, and populates fn with it. |
| func (r *reader) funcBody(fn *ir.Func) { |
| r.curfn = fn |
| r.closureVars = fn.ClosureVars |
| if len(r.closureVars) != 0 && r.hasTypeParams() { |
| r.dictParam = r.closureVars[len(r.closureVars)-1] // dictParam is last; see reader.funcLit |
| } |
| |
| ir.WithFunc(fn, func() { |
| r.funcargs(fn) |
| |
| if r.syntheticBody(fn.Pos()) { |
| return |
| } |
| |
| if !r.Bool() { |
| return |
| } |
| |
| body := r.stmts() |
| if body == nil { |
| body = []ir.Node{typecheck.Stmt(ir.NewBlockStmt(src.NoXPos, nil))} |
| } |
| fn.Body = body |
| fn.Endlineno = r.pos() |
| }) |
| |
| r.marker.WriteTo(fn) |
| } |
| |
| // syntheticBody adds a synthetic body to r.curfn if appropriate, and |
| // reports whether it did. |
| func (r *reader) syntheticBody(pos src.XPos) bool { |
| if r.synthetic != nil { |
| r.synthetic(pos, r) |
| return true |
| } |
| |
| // If this function has type parameters and isn't shaped, then we |
| // just tail call its corresponding shaped variant. |
| if r.hasTypeParams() && !r.dict.shaped { |
| r.callShaped(pos) |
| return true |
| } |
| |
| return false |
| } |
| |
| // callShaped emits a tail call to r.shapedFn, passing along the |
| // arguments to the current function. |
| func (r *reader) callShaped(pos src.XPos) { |
| shapedObj := r.dict.shapedObj |
| assert(shapedObj != nil) |
| |
| var shapedFn ir.Node |
| if r.methodSym == nil { |
| // Instantiating a generic function; shapedObj is the shaped |
| // function itself. |
| assert(shapedObj.Op() == ir.ONAME && shapedObj.Class == ir.PFUNC) |
| shapedFn = shapedObj |
| } else { |
| // Instantiating a generic type's method; shapedObj is the shaped |
| // type, so we need to select it's corresponding method. |
| shapedFn = shapedMethodExpr(pos, shapedObj, r.methodSym) |
| } |
| |
| recvs, params := r.syntheticArgs(pos) |
| |
| // Construct the arguments list: receiver (if any), then runtime |
| // dictionary, and finally normal parameters. |
| // |
| // Note: For simplicity, shaped methods are added as normal methods |
| // on their shaped types. So existing code (e.g., packages ir and |
| // typecheck) expects the shaped type to appear as the receiver |
| // parameter (or first parameter, as a method expression). Hence |
| // putting the dictionary parameter after that is the least invasive |
| // solution at the moment. |
| var args ir.Nodes |
| args.Append(recvs...) |
| args.Append(typecheck.Expr(ir.NewAddrExpr(pos, r.p.dictNameOf(r.dict)))) |
| args.Append(params...) |
| |
| r.syntheticTailCall(pos, shapedFn, args) |
| } |
| |
| // syntheticArgs returns the recvs and params arguments passed to the |
| // current function. |
| func (r *reader) syntheticArgs(pos src.XPos) (recvs, params ir.Nodes) { |
| sig := r.curfn.Nname.Type() |
| |
| inlVarIdx := 0 |
| addParams := func(out *ir.Nodes, params []*types.Field) { |
| for _, param := range params { |
| var arg ir.Node |
| if param.Nname != nil { |
| name := param.Nname.(*ir.Name) |
| if !ir.IsBlank(name) { |
| if r.inlCall != nil { |
| // During inlining, we want the respective inlvar where we |
| // assigned the callee's arguments. |
| arg = r.inlvars[inlVarIdx] |
| } else { |
| // Otherwise, we can use the parameter itself directly. |
| base.AssertfAt(name.Curfn == r.curfn, name.Pos(), "%v has curfn %v, but want %v", name, name.Curfn, r.curfn) |
| arg = name |
| } |
| } |
| } |
| |
| // For anonymous and blank parameters, we don't have an *ir.Name |
| // to use as the argument. However, since we know the shaped |
| // function won't use the value either, we can just pass the |
| // zero value. (Also unfortunately, we don't have an easy |
| // zero-value IR node; so we use a default-initialized temporary |
| // variable.) |
| if arg == nil { |
| tmp := typecheck.TempAt(pos, r.curfn, param.Type) |
| r.curfn.Body.Append( |
| typecheck.Stmt(ir.NewDecl(pos, ir.ODCL, tmp)), |
| typecheck.Stmt(ir.NewAssignStmt(pos, tmp, nil)), |
| ) |
| arg = tmp |
| } |
| |
| out.Append(arg) |
| inlVarIdx++ |
| } |
| } |
| |
| addParams(&recvs, sig.Recvs().FieldSlice()) |
| addParams(¶ms, sig.Params().FieldSlice()) |
| return |
| } |
| |
| // syntheticTailCall emits a tail call to fn, passing the given |
| // arguments list. |
| func (r *reader) syntheticTailCall(pos src.XPos, fn ir.Node, args ir.Nodes) { |
| // Mark the function as a wrapper so it doesn't show up in stack |
| // traces. |
| r.curfn.SetWrapper(true) |
| |
| call := typecheck.Call(pos, fn, args, fn.Type().IsVariadic()).(*ir.CallExpr) |
| |
| var stmt ir.Node |
| if fn.Type().NumResults() != 0 { |
| stmt = typecheck.Stmt(ir.NewReturnStmt(pos, []ir.Node{call})) |
| } else { |
| stmt = call |
| } |
| r.curfn.Body.Append(stmt) |
| } |
| |
| // dictNameOf returns the runtime dictionary corresponding to dict. |
| func (pr *pkgReader) dictNameOf(dict *readerDict) *ir.Name { |
| pos := base.AutogeneratedPos |
| |
| // Check that we only instantiate runtime dictionaries with real types. |
| base.AssertfAt(!dict.shaped, pos, "runtime dictionary of shaped object %v", dict.baseSym) |
| |
| sym := dict.baseSym.Pkg.Lookup(objabi.GlobalDictPrefix + "." + dict.baseSym.Name) |
| if sym.Def != nil { |
| return sym.Def.(*ir.Name) |
| } |
| |
| name := ir.NewNameAt(pos, sym) |
| name.Class = ir.PEXTERN |
| sym.Def = name // break cycles with mutual subdictionaries |
| |
| lsym := name.Linksym() |
| ot := 0 |
| |
| assertOffset := func(section string, offset int) { |
| base.AssertfAt(ot == offset*types.PtrSize, pos, "writing section %v at offset %v, but it should be at %v*%v", section, ot, offset, types.PtrSize) |
| } |
| |
| assertOffset("type param method exprs", dict.typeParamMethodExprsOffset()) |
| for _, info := range dict.typeParamMethodExprs { |
| typeParam := dict.targs[info.typeParamIdx] |
| method := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(typeParam), info.method)).(*ir.SelectorExpr) |
| assert(method.Op() == ir.OMETHEXPR) |
| |
| rsym := method.FuncName().Linksym() |
| assert(rsym.ABI() == obj.ABIInternal) // must be ABIInternal; see ir.OCFUNC in ssagen/ssa.go |
| |
| ot = objw.SymPtr(lsym, ot, rsym, 0) |
| } |
| |
| assertOffset("subdictionaries", dict.subdictsOffset()) |
| for _, info := range dict.subdicts { |
| explicits := pr.typListIdx(info.explicits, dict) |
| |
| // Careful: Due to subdictionary cycles, name may not be fully |
| // initialized yet. |
| name := pr.objDictName(info.idx, dict.targs, explicits) |
| |
| ot = objw.SymPtr(lsym, ot, name.Linksym(), 0) |
| } |
| |
| assertOffset("rtypes", dict.rtypesOffset()) |
| for _, info := range dict.rtypes { |
| typ := pr.typIdx(info, dict, true) |
| ot = objw.SymPtr(lsym, ot, reflectdata.TypeLinksym(typ), 0) |
| |
| // TODO(mdempsky): Double check this. |
| reflectdata.MarkTypeUsedInInterface(typ, lsym) |
| } |
| |
| // For each (typ, iface) pair, we write the *runtime.itab pointer |
| // for the pair. For pairs that don't actually require an itab |
| // (i.e., typ is an interface, or iface is an empty interface), we |
| // write a nil pointer instead. This is wasteful, but rare in |
| // practice (e.g., instantiating a type parameter with an interface |
| // type). |
| assertOffset("itabs", dict.itabsOffset()) |
| for _, info := range dict.itabs { |
| typ := pr.typIdx(info.typ, dict, true) |
| iface := pr.typIdx(info.iface, dict, true) |
| |
| if !typ.IsInterface() && iface.IsInterface() && !iface.IsEmptyInterface() { |
| ot = objw.SymPtr(lsym, ot, reflectdata.ITabLsym(typ, iface), 0) |
| } else { |
| ot += types.PtrSize |
| } |
| |
| // TODO(mdempsky): Double check this. |
| reflectdata.MarkTypeUsedInInterface(typ, lsym) |
| reflectdata.MarkTypeUsedInInterface(iface, lsym) |
| } |
| |
| objw.Global(lsym, int32(ot), obj.DUPOK|obj.RODATA) |
| |
| name.SetType(dict.varType()) |
| name.SetTypecheck(1) |
| |
| return name |
| } |
| |
| // typeParamMethodExprsOffset returns the offset of the runtime |
| // dictionary's type parameter method expressions section, in words. |
| func (dict *readerDict) typeParamMethodExprsOffset() int { |
| return 0 |
| } |
| |
| // subdictsOffset returns the offset of the runtime dictionary's |
| // subdictionary section, in words. |
| func (dict *readerDict) subdictsOffset() int { |
| return dict.typeParamMethodExprsOffset() + len(dict.typeParamMethodExprs) |
| } |
| |
| // rtypesOffset returns the offset of the runtime dictionary's rtypes |
| // section, in words. |
| func (dict *readerDict) rtypesOffset() int { |
| return dict.subdictsOffset() + len(dict.subdicts) |
| } |
| |
| // itabsOffset returns the offset of the runtime dictionary's itabs |
| // section, in words. |
| func (dict *readerDict) itabsOffset() int { |
| return dict.rtypesOffset() + len(dict.rtypes) |
| } |
| |
| // numWords returns the total number of words that comprise dict's |
| // runtime dictionary variable. |
| func (dict *readerDict) numWords() int64 { |
| return int64(dict.itabsOffset() + len(dict.itabs)) |
| } |
| |
| // varType returns the type of dict's runtime dictionary variable. |
| func (dict *readerDict) varType() *types.Type { |
| return types.NewArray(types.Types[types.TUINTPTR], dict.numWords()) |
| } |
| |
| func (r *reader) funcargs(fn *ir.Func) { |
| sig := fn.Nname.Type() |
| |
| if recv := sig.Recv(); recv != nil { |
| r.funcarg(recv, recv.Sym, ir.PPARAM) |
| } |
| for _, param := range sig.Params().FieldSlice() { |
| r.funcarg(param, param.Sym, ir.PPARAM) |
| } |
| |
| for i, param := range sig.Results().FieldSlice() { |
| sym := types.OrigSym(param.Sym) |
| |
| if sym == nil || sym.IsBlank() { |
| prefix := "~r" |
| if r.inlCall != nil { |
| prefix = "~R" |
| } else if sym != nil { |
| prefix = "~b" |
| } |
| sym = typecheck.LookupNum(prefix, i) |
| } |
| |
| r.funcarg(param, sym, ir.PPARAMOUT) |
| } |
| } |
| |
| func (r *reader) funcarg(param *types.Field, sym *types.Sym, ctxt ir.Class) { |
| if sym == nil { |
| assert(ctxt == ir.PPARAM) |
| if r.inlCall != nil { |
| r.inlvars.Append(ir.BlankNode) |
| } |
| return |
| } |
| |
| name := ir.NewNameAt(r.inlPos(param.Pos), sym) |
| setType(name, param.Type) |
| r.addLocal(name, ctxt) |
| |
| if r.inlCall == nil { |
| if !r.funarghack { |
| param.Sym = sym |
| param.Nname = name |
| } |
| } else { |
| if ctxt == ir.PPARAMOUT { |
| r.retvars.Append(name) |
| } else { |
| r.inlvars.Append(name) |
| } |
| } |
| } |
| |
| func (r *reader) addLocal(name *ir.Name, ctxt ir.Class) { |
| assert(ctxt == ir.PAUTO || ctxt == ir.PPARAM || ctxt == ir.PPARAMOUT) |
| |
| if name.Sym().Name == dictParamName { |
| r.dictParam = name |
| } else { |
| if r.synthetic == nil { |
| r.Sync(pkgbits.SyncAddLocal) |
| if r.p.SyncMarkers() { |
| want := r.Int() |
| if have := len(r.locals); have != want { |
| base.FatalfAt(name.Pos(), "locals table has desynced") |
| } |
| } |
| r.varDictIndex(name) |
| } |
| |
| r.locals = append(r.locals, name) |
| } |
| |
| name.SetUsed(true) |
| |
| // TODO(mdempsky): Move earlier. |
| if ir.IsBlank(name) { |
| return |
| } |
| |
| if r.inlCall != nil { |
| if ctxt == ir.PAUTO { |
| name.SetInlLocal(true) |
| } else { |
| name.SetInlFormal(true) |
| ctxt = ir.PAUTO |
| } |
| } |
| |
| name.Class = ctxt |
| name.Curfn = r.curfn |
| |
| r.curfn.Dcl = append(r.curfn.Dcl, name) |
| |
| if ctxt == ir.PAUTO { |
| name.SetFrameOffset(0) |
| } |
| } |
| |
| func (r *reader) useLocal() *ir.Name { |
| r.Sync(pkgbits.SyncUseObjLocal) |
| if r.Bool() { |
| return r.locals[r.Len()] |
| } |
| return r.closureVars[r.Len()] |
| } |
| |
| func (r *reader) openScope() { |
| r.Sync(pkgbits.SyncOpenScope) |
| pos := r.pos() |
| |
| if base.Flag.Dwarf { |
| r.scopeVars = append(r.scopeVars, len(r.curfn.Dcl)) |
| r.marker.Push(pos) |
| } |
| } |
| |
| func (r *reader) closeScope() { |
| r.Sync(pkgbits.SyncCloseScope) |
| r.lastCloseScopePos = r.pos() |
| |
| r.closeAnotherScope() |
| } |
| |
| // closeAnotherScope is like closeScope, but it reuses the same mark |
| // position as the last closeScope call. This is useful for "for" and |
| // "if" statements, as their implicit blocks always end at the same |
| // position as an explicit block. |
| func (r *reader) closeAnotherScope() { |
| r.Sync(pkgbits.SyncCloseAnotherScope) |
| |
| if base.Flag.Dwarf { |
| scopeVars := r.scopeVars[len(r.scopeVars)-1] |
| r.scopeVars = r.scopeVars[:len(r.scopeVars)-1] |
| |
| // Quirkish: noder decides which scopes to keep before |
| // typechecking, whereas incremental typechecking during IR |
| // construction can result in new autotemps being allocated. To |
| // produce identical output, we ignore autotemps here for the |
| // purpose of deciding whether to retract the scope. |
| // |
| // This is important for net/http/fcgi, because it contains: |
| // |
| // var body io.ReadCloser |
| // if len(content) > 0 { |
| // body, req.pw = io.Pipe() |
| // } else { … } |
| // |
| // Notably, io.Pipe is inlinable, and inlining it introduces a ~R0 |
| // variable at the call site. |
| // |
| // Noder does not preserve the scope where the io.Pipe() call |
| // resides, because it doesn't contain any declared variables in |
| // source. So the ~R0 variable ends up being assigned to the |
| // enclosing scope instead. |
| // |
| // However, typechecking this assignment also introduces |
| // autotemps, because io.Pipe's results need conversion before |
| // they can be assigned to their respective destination variables. |
| // |
| // TODO(mdempsky): We should probably just keep all scopes, and |
| // let dwarfgen take care of pruning them instead. |
| retract := true |
| for _, n := range r.curfn.Dcl[scopeVars:] { |
| if !n.AutoTemp() { |
| retract = false |
| break |
| } |
| } |
| |
| if retract { |
| // no variables were declared in this scope, so we can retract it. |
| r.marker.Unpush() |
| } else { |
| r.marker.Pop(r.lastCloseScopePos) |
| } |
| } |
| } |
| |
| // @@@ Statements |
| |
| func (r *reader) stmt() ir.Node { |
| switch stmts := r.stmts(); len(stmts) { |
| case 0: |
| return nil |
| case 1: |
| return stmts[0] |
| default: |
| return ir.NewBlockStmt(stmts[0].Pos(), stmts) |
| } |
| } |
| |
| func (r *reader) stmts() []ir.Node { |
| assert(ir.CurFunc == r.curfn) |
| var res ir.Nodes |
| |
| r.Sync(pkgbits.SyncStmts) |
| for { |
| tag := codeStmt(r.Code(pkgbits.SyncStmt1)) |
| if tag == stmtEnd { |
| r.Sync(pkgbits.SyncStmtsEnd) |
| return res |
| } |
| |
| if n := r.stmt1(tag, &res); n != nil { |
| res.Append(typecheck.Stmt(n)) |
| } |
| } |
| } |
| |
| func (r *reader) stmt1(tag codeStmt, out *ir.Nodes) ir.Node { |
| var label *types.Sym |
| if n := len(*out); n > 0 { |
| if ls, ok := (*out)[n-1].(*ir.LabelStmt); ok { |
| label = ls.Label |
| } |
| } |
| |
| switch tag { |
| default: |
| panic("unexpected statement") |
| |
| case stmtAssign: |
| pos := r.pos() |
| names, lhs := r.assignList() |
| rhs := r.multiExpr() |
| |
| if len(rhs) == 0 { |
| for _, name := range names { |
| as := ir.NewAssignStmt(pos, name, nil) |
| as.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, name)) |
| out.Append(typecheck.Stmt(as)) |
| } |
| return nil |
| } |
| |
| if len(lhs) == 1 && len(rhs) == 1 { |
| n := ir.NewAssignStmt(pos, lhs[0], rhs[0]) |
| n.Def = r.initDefn(n, names) |
| return n |
| } |
| |
| n := ir.NewAssignListStmt(pos, ir.OAS2, lhs, rhs) |
| n.Def = r.initDefn(n, names) |
| return n |
| |
| case stmtAssignOp: |
| op := r.op() |
| lhs := r.expr() |
| pos := r.pos() |
| rhs := r.expr() |
| return ir.NewAssignOpStmt(pos, op, lhs, rhs) |
| |
| case stmtIncDec: |
| op := r.op() |
| lhs := r.expr() |
| pos := r.pos() |
| n := ir.NewAssignOpStmt(pos, op, lhs, ir.NewBasicLit(pos, one)) |
| n.IncDec = true |
| return n |
| |
| case stmtBlock: |
| out.Append(r.blockStmt()...) |
| return nil |
| |
| case stmtBranch: |
| pos := r.pos() |
| op := r.op() |
| sym := r.optLabel() |
| return ir.NewBranchStmt(pos, op, sym) |
| |
| case stmtCall: |
| pos := r.pos() |
| op := r.op() |
| call := r.expr() |
| return ir.NewGoDeferStmt(pos, op, call) |
| |
| case stmtExpr: |
| return r.expr() |
| |
| case stmtFor: |
| return r.forStmt(label) |
| |
| case stmtIf: |
| return r.ifStmt() |
| |
| case stmtLabel: |
| pos := r.pos() |
| sym := r.label() |
| return ir.NewLabelStmt(pos, sym) |
| |
| case stmtReturn: |
| pos := r.pos() |
| results := r.multiExpr() |
| return ir.NewReturnStmt(pos, results) |
| |
| case stmtSelect: |
| return r.selectStmt(label) |
| |
| case stmtSend: |
| pos := r.pos() |
| ch := r.expr() |
| value := r.expr() |
| return ir.NewSendStmt(pos, ch, value) |
| |
| case stmtSwitch: |
| return r.switchStmt(label) |
| } |
| } |
| |
| func (r *reader) assignList() ([]*ir.Name, []ir.Node) { |
| lhs := make([]ir.Node, r.Len()) |
| var names []*ir.Name |
| |
| for i := range lhs { |
| expr, def := r.assign() |
| lhs[i] = expr |
| if def { |
| names = append(names, expr.(*ir.Name)) |
| } |
| } |
| |
| return names, lhs |
| } |
| |
| // assign returns an assignee expression. It also reports whether the |
| // returned expression is a newly declared variable. |
| func (r *reader) assign() (ir.Node, bool) { |
| switch tag := codeAssign(r.Code(pkgbits.SyncAssign)); tag { |
| default: |
| panic("unhandled assignee expression") |
| |
| case assignBlank: |
| return typecheck.AssignExpr(ir.BlankNode), false |
| |
| case assignDef: |
| pos := r.pos() |
| setBasePos(pos) |
| _, sym := r.localIdent() |
| typ := r.typ() |
| |
| name := ir.NewNameAt(pos, sym) |
| setType(name, typ) |
| r.addLocal(name, ir.PAUTO) |
| return name, true |
| |
| case assignExpr: |
| return r.expr(), false |
| } |
| } |
| |
| func (r *reader) blockStmt() []ir.Node { |
| r.Sync(pkgbits.SyncBlockStmt) |
| r.openScope() |
| stmts := r.stmts() |
| r.closeScope() |
| return stmts |
| } |
| |
| func (r *reader) forStmt(label *types.Sym) ir.Node { |
| r.Sync(pkgbits.SyncForStmt) |
| |
| r.openScope() |
| |
| if r.Bool() { |
| pos := r.pos() |
| rang := ir.NewRangeStmt(pos, nil, nil, nil, nil, false) |
| rang.Label = label |
| |
| names, lhs := r.assignList() |
| if len(lhs) >= 1 { |
| rang.Key = lhs[0] |
| if len(lhs) >= 2 { |
| rang.Value = lhs[1] |
| } |
| } |
| rang.Def = r.initDefn(rang, names) |
| |
| rang.X = r.expr() |
| if rang.X.Type().IsMap() { |
| rang.RType = r.rtype(pos) |
| } |
| if rang.Key != nil && !ir.IsBlank(rang.Key) { |
| rang.KeyTypeWord, rang.KeySrcRType = r.convRTTI(pos) |
| } |
| if rang.Value != nil && !ir.IsBlank(rang.Value) { |
| rang.ValueTypeWord, rang.ValueSrcRType = r.convRTTI(pos) |
| } |
| |
| rang.Body = r.blockStmt() |
| rang.DistinctVars = r.Bool() |
| r.closeAnotherScope() |
| |
| return rang |
| } |
| |
| pos := r.pos() |
| init := r.stmt() |
| cond := r.optExpr() |
| post := r.stmt() |
| body := r.blockStmt() |
| perLoopVars := r.Bool() |
| r.closeAnotherScope() |
| |
| stmt := ir.NewForStmt(pos, init, cond, post, body, perLoopVars) |
| stmt.Label = label |
| return stmt |
| } |
| |
| func (r *reader) ifStmt() ir.Node { |
| r.Sync(pkgbits.SyncIfStmt) |
| r.openScope() |
| pos := r.pos() |
| init := r.stmts() |
| cond := r.expr() |
| then := r.blockStmt() |
| els := r.stmts() |
| n := ir.NewIfStmt(pos, cond, then, els) |
| n.SetInit(init) |
| r.closeAnotherScope() |
| return n |
| } |
| |
| func (r *reader) selectStmt(label *types.Sym) ir.Node { |
| r.Sync(pkgbits.SyncSelectStmt) |
| |
| pos := r.pos() |
| clauses := make([]*ir.CommClause, r.Len()) |
| for i := range clauses { |
| if i > 0 { |
| r.closeScope() |
| } |
| r.openScope() |
| |
| pos := r.pos() |
| comm := r.stmt() |
| body := r.stmts() |
| |
| // "case i = <-c: ..." may require an implicit conversion (e.g., |
| // see fixedbugs/bug312.go). Currently, typecheck throws away the |
| // implicit conversion and relies on it being reinserted later, |
| // but that would lose any explicit RTTI operands too. To preserve |
| // RTTI, we rewrite this as "case tmp := <-c: i = tmp; ...". |
| if as, ok := comm.(*ir.AssignStmt); ok && as.Op() == ir.OAS && !as.Def { |
| if conv, ok := as.Y.(*ir.ConvExpr); ok && conv.Op() == ir.OCONVIFACE { |
| base.AssertfAt(conv.Implicit(), conv.Pos(), "expected implicit conversion: %v", conv) |
| |
| recv := conv.X |
| base.AssertfAt(recv.Op() == ir.ORECV, recv.Pos(), "expected receive expression: %v", recv) |
| |
| tmp := r.temp(pos, recv.Type()) |
| |
| // Replace comm with `tmp := <-c`. |
| tmpAs := ir.NewAssignStmt(pos, tmp, recv) |
| tmpAs.Def = true |
| tmpAs.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, tmp)) |
| comm = tmpAs |
| |
| // Change original assignment to `i = tmp`, and prepend to body. |
| conv.X = tmp |
| body = append([]ir.Node{as}, body...) |
| } |
| } |
| |
| // multiExpr will have desugared a comma-ok receive expression |
| // into a separate statement. However, the rest of the compiler |
| // expects comm to be the OAS2RECV statement itself, so we need to |
| // shuffle things around to fit that pattern. |
| if as2, ok := comm.(*ir.AssignListStmt); ok && as2.Op() == ir.OAS2 { |
| init := ir.TakeInit(as2.Rhs[0]) |
| base.AssertfAt(len(init) == 1 && init[0].Op() == ir.OAS2RECV, as2.Pos(), "unexpected assignment: %+v", as2) |
| |
| comm = init[0] |
| body = append([]ir.Node{as2}, body...) |
| } |
| |
| clauses[i] = ir.NewCommStmt(pos, comm, body) |
| } |
| if len(clauses) > 0 { |
| r.closeScope() |
| } |
| n := ir.NewSelectStmt(pos, clauses) |
| n.Label = label |
| return n |
| } |
| |
| func (r *reader) switchStmt(label *types.Sym) ir.Node { |
| r.Sync(pkgbits.SyncSwitchStmt) |
| |
| r.openScope() |
| pos := r.pos() |
| init := r.stmt() |
| |
| var tag ir.Node |
| var ident *ir.Ident |
| var iface *types.Type |
| if r.Bool() { |
| pos := r.pos() |
| if r.Bool() { |
| pos := r.pos() |
| _, sym := r.localIdent() |
| ident = ir.NewIdent(pos, sym) |
| } |
| x := r.expr() |
| iface = x.Type() |
| tag = ir.NewTypeSwitchGuard(pos, ident, x) |
| } else { |
| tag = r.optExpr() |
| } |
| |
| clauses := make([]*ir.CaseClause, r.Len()) |
| for i := range clauses { |
| if i > 0 { |
| r.closeScope() |
| } |
| r.openScope() |
| |
| pos := r.pos() |
| var cases, rtypes []ir.Node |
| if iface != nil { |
| cases = make([]ir.Node, r.Len()) |
| if len(cases) == 0 { |
| cases = nil // TODO(mdempsky): Unclear if this matters. |
| } |
| for i := range cases { |
| if r.Bool() { // case nil |
| cases[i] = typecheck.Expr(types.BuiltinPkg.Lookup("nil").Def.(*ir.NilExpr)) |
| } else { |
| cases[i] = r.exprType() |
| } |
| } |
| } else { |
| cases = r.exprList() |
| |
| // For `switch { case any(true): }` (e.g., issue 3980 in |
| // test/switch.go), the backend still creates a mixed bool/any |
| // comparison, and we need to explicitly supply the RTTI for the |
| // comparison. |
| // |
| // TODO(mdempsky): Change writer.go to desugar "switch {" into |
| // "switch true {", which we already handle correctly. |
| if tag == nil { |
| for i, cas := range cases { |
| if cas.Type().IsEmptyInterface() { |
| for len(rtypes) < i { |
| rtypes = append(rtypes, nil) |
| } |
| rtypes = append(rtypes, reflectdata.TypePtrAt(cas.Pos(), types.Types[types.TBOOL])) |
| } |
| } |
| } |
| } |
| |
| clause := ir.NewCaseStmt(pos, cases, nil) |
| clause.RTypes = rtypes |
| |
| if ident != nil { |
| pos := r.pos() |
| typ := r.typ() |
| |
| name := ir.NewNameAt(pos, ident.Sym()) |
| setType(name, typ) |
| r.addLocal(name, ir.PAUTO) |
| clause.Var = name |
| name.Defn = tag |
| } |
| |
| clause.Body = r.stmts() |
| clauses[i] = clause |
| } |
| if len(clauses) > 0 { |
| r.closeScope() |
| } |
| r.closeScope() |
| |
| n := ir.NewSwitchStmt(pos, tag, clauses) |
| n.Label = label |
| if init != nil { |
| n.SetInit([]ir.Node{init}) |
| } |
| return n |
| } |
| |
| func (r *reader) label() *types.Sym { |
| r.Sync(pkgbits.SyncLabel) |
| name := r.String() |
| if r.inlCall != nil { |
| name = fmt.Sprintf("~%s·%d", name, inlgen) |
| } |
| return typecheck.Lookup(name) |
| } |
| |
| func (r *reader) optLabel() *types.Sym { |
| r.Sync(pkgbits.SyncOptLabel) |
| if r.Bool() { |
| return r.label() |
| } |
| return nil |
| } |
| |
| // initDefn marks the given names as declared by defn and populates |
| // its Init field with ODCL nodes. It then reports whether any names |
| // were so declared, which can be used to initialize defn.Def. |
| func (r *reader) initDefn(defn ir.InitNode, names []*ir.Name) bool { |
| if len(names) == 0 { |
| return false |
| } |
| |
| init := make([]ir.Node, len(names)) |
| for i, name := range names { |
| name.Defn = defn |
| init[i] = ir.NewDecl(name.Pos(), ir.ODCL, name) |
| } |
| defn.SetInit(init) |
| return true |
| } |
| |
| // @@@ Expressions |
| |
| // expr reads and returns a typechecked expression. |
| func (r *reader) expr() (res ir.Node) { |
| defer func() { |
| if res != nil && res.Typecheck() == 0 { |
| base.FatalfAt(res.Pos(), "%v missed typecheck", res) |
| } |
| }() |
| |
| switch tag := codeExpr(r.Code(pkgbits.SyncExpr)); tag { |
| default: |
| panic("unhandled expression") |
| |
| case exprLocal: |
| return typecheck.Expr(r.useLocal()) |
| |
| case exprGlobal: |
| // Callee instead of Expr allows builtins |
| // TODO(mdempsky): Handle builtins directly in exprCall, like method calls? |
| return typecheck.Callee(r.obj()) |
| |
| case exprFuncInst: |
| origPos, pos := r.origPos() |
| wrapperFn, baseFn, dictPtr := r.funcInst(pos) |
| if wrapperFn != nil { |
| return wrapperFn |
| } |
| return r.curry(origPos, false, baseFn, dictPtr, nil) |
| |
| case exprConst: |
| pos := r.pos() |
| typ := r.typ() |
| val := FixValue(typ, r.Value()) |
| op := r.op() |
| orig := r.String() |
| return typecheck.Expr(OrigConst(pos, typ, val, op, orig)) |
| |
| case exprNil: |
| pos := r.pos() |
| typ := r.typ() |
| return Nil(pos, typ) |
| |
| case exprCompLit: |
| return r.compLit() |
| |
| case exprFuncLit: |
| return r.funcLit() |
| |
| case exprFieldVal: |
| x := r.expr() |
| pos := r.pos() |
| _, sym := r.selector() |
| |
| return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, x, sym)).(*ir.SelectorExpr) |
| |
| case exprMethodVal: |
| recv := r.expr() |
| origPos, pos := r.origPos() |
| wrapperFn, baseFn, dictPtr := r.methodExpr() |
| |
| // For simple wrapperFn values, the existing machinery for creating |
| // and deduplicating wrapperFn value wrappers still works fine. |
| if wrapperFn, ok := wrapperFn.(*ir.SelectorExpr); ok && wrapperFn.Op() == ir.OMETHEXPR { |
| // The receiver expression we constructed may have a shape type. |
| // For example, in fixedbugs/issue54343.go, `New[int]()` is |
| // constructed as `New[go.shape.int](&.dict.New[int])`, which |
| // has type `*T[go.shape.int]`, not `*T[int]`. |
| // |
| // However, the method we want to select here is `(*T[int]).M`, |
| // not `(*T[go.shape.int]).M`, so we need to manually convert |
| // the type back so that the OXDOT resolves correctly. |
| // |
| // TODO(mdempsky): Logically it might make more sense for |
| // exprCall to take responsibility for setting a non-shaped |
| // result type, but this is the only place where we care |
| // currently. And only because existing ir.OMETHVALUE backend |
| // code relies on n.X.Type() instead of n.Selection.Recv().Type |
| // (because the latter is types.FakeRecvType() in the case of |
| // interface method values). |
| // |
| if recv.Type().HasShape() { |
| typ := wrapperFn.Type().Params().Field(0).Type |
| if !types.Identical(typ, recv.Type()) { |
| base.FatalfAt(wrapperFn.Pos(), "receiver %L does not match %L", recv, wrapperFn) |
| } |
| recv = typecheck.Expr(ir.NewConvExpr(recv.Pos(), ir.OCONVNOP, typ, recv)) |
| } |
| |
| n := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, recv, wrapperFn.Sel)).(*ir.SelectorExpr) |
| |
| // As a consistency check here, we make sure "n" selected the |
| // same method (represented by a types.Field) that wrapperFn |
| // selected. However, for anonymous receiver types, there can be |
| // multiple such types.Field instances (#58563). So we may need |
| // to fallback to making sure Sym and Type (including the |
| // receiver parameter's type) match. |
| if n.Selection != wrapperFn.Selection { |
| assert(n.Selection.Sym == wrapperFn.Selection.Sym) |
| assert(types.Identical(n.Selection.Type, wrapperFn.Selection.Type)) |
| assert(types.Identical(n.Selection.Type.Recv().Type, wrapperFn.Selection.Type.Recv().Type)) |
| } |
| |
| wrapper := methodValueWrapper{ |
| rcvr: n.X.Type(), |
| method: n.Selection, |
| } |
| |
| if r.importedDef() { |
| haveMethodValueWrappers = append(haveMethodValueWrappers, wrapper) |
| } else { |
| needMethodValueWrappers = append(needMethodValueWrappers, wrapper) |
| } |
| return n |
| } |
| |
| // For more complicated method expressions, we construct a |
| // function literal wrapper. |
| return r.curry(origPos, true, baseFn, recv, dictPtr) |
| |
| case exprMethodExpr: |
| recv := r.typ() |
| |
| implicits := make([]int, r.Len()) |
| for i := range implicits { |
| implicits[i] = r.Len() |
| } |
| var deref, addr bool |
| if r.Bool() { |
| deref = true |
| } else if r.Bool() { |
| addr = true |
| } |
| |
| origPos, pos := r.origPos() |
| wrapperFn, baseFn, dictPtr := r.methodExpr() |
| |
| // If we already have a wrapper and don't need to do anything with |
| // it, we can just return the wrapper directly. |
| // |
| // N.B., we use implicits/deref/addr here as the source of truth |
| // rather than types.Identical, because the latter can be confused |
| // by tricky promoted methods (e.g., typeparam/mdempsky/21.go). |
| if wrapperFn != nil && len(implicits) == 0 && !deref && !addr { |
| if !types.Identical(recv, wrapperFn.Type().Params().Field(0).Type) { |
| base.FatalfAt(pos, "want receiver type %v, but have method %L", recv, wrapperFn) |
| } |
| return wrapperFn |
| } |
| |
| // Otherwise, if the wrapper function is a static method |
| // expression (OMETHEXPR) and the receiver type is unshaped, then |
| // we can rely on a statically generated wrapper being available. |
| if method, ok := wrapperFn.(*ir.SelectorExpr); ok && method.Op() == ir.OMETHEXPR && !recv.HasShape() { |
| return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), method.Sel)).(*ir.SelectorExpr) |
| } |
| |
| return r.methodExprWrap(origPos, recv, implicits, deref, addr, baseFn, dictPtr) |
| |
| case exprIndex: |
| x := r.expr() |
| pos := r.pos() |
| index := r.expr() |
| n := typecheck.Expr(ir.NewIndexExpr(pos, x, index)) |
| switch n.Op() { |
| case ir.OINDEXMAP: |
| n := n.(*ir.IndexExpr) |
| n.RType = r.rtype(pos) |
| } |
| return n |
| |
| case exprSlice: |
| x := r.expr() |
| pos := r.pos() |
| var index [3]ir.Node |
| for i := range index { |
| index[i] = r.optExpr() |
| } |
| op := ir.OSLICE |
| if index[2] != nil { |
| op = ir.OSLICE3 |
| } |
| return typecheck.Expr(ir.NewSliceExpr(pos, op, x, index[0], index[1], index[2])) |
| |
| case exprAssert: |
| x := r.expr() |
| pos := r.pos() |
| typ := r.exprType() |
| srcRType := r.rtype(pos) |
| |
| // TODO(mdempsky): Always emit ODYNAMICDOTTYPE for uniformity? |
| if typ, ok := typ.(*ir.DynamicType); ok && typ.Op() == ir.ODYNAMICTYPE { |
| assert := ir.NewDynamicTypeAssertExpr(pos, ir.ODYNAMICDOTTYPE, x, typ.RType) |
| assert.SrcRType = srcRType |
| assert.ITab = typ.ITab |
| return typed(typ.Type(), assert) |
| } |
| return typecheck.Expr(ir.NewTypeAssertExpr(pos, x, typ.Type())) |
| |
| case exprUnaryOp: |
| op := r.op() |
| pos := r.pos() |
| x := r.expr() |
| |
| switch op { |
| case ir.OADDR: |
| return typecheck.Expr(typecheck.NodAddrAt(pos, x)) |
| case ir.ODEREF: |
| return typecheck.Expr(ir.NewStarExpr(pos, x)) |
| } |
| return typecheck.Expr(ir.NewUnaryExpr(pos, op, x)) |
| |
| case exprBinaryOp: |
| op := r.op() |
| x := r.expr() |
| pos := r.pos() |
| y := r.expr() |
| |
| switch op { |
| case ir.OANDAND, ir.OOROR: |
| return typecheck.Expr(ir.NewLogicalExpr(pos, op, x, y)) |
| } |
| return typecheck.Expr(ir.NewBinaryExpr(pos, op, x, y)) |
| |
| case exprRecv: |
| x := r.expr() |
| pos := r.pos() |
| for i, n := 0, r.Len(); i < n; i++ { |
| x = Implicit(DotField(pos, x, r.Len())) |
| } |
| if r.Bool() { // needs deref |
| x = Implicit(Deref(pos, x.Type().Elem(), x)) |
| } else if r.Bool() { // needs addr |
| x = Implicit(Addr(pos, x)) |
| } |
| return x |
| |
| case exprCall: |
| var fun ir.Node |
| var args ir.Nodes |
| if r.Bool() { // method call |
| recv := r.expr() |
| _, method, dictPtr := r.methodExpr() |
| |
| if recv.Type().IsInterface() && method.Op() == ir.OMETHEXPR { |
| method := method.(*ir.SelectorExpr) |
| |
| // The compiler backend (e.g., devirtualization) handle |
| // OCALLINTER/ODOTINTER better than OCALLFUNC/OMETHEXPR for |
| // interface calls, so we prefer to continue constructing |
| // calls that way where possible. |
| // |
| // There are also corner cases where semantically it's perhaps |
| // significant; e.g., fixedbugs/issue15975.go, #38634, #52025. |
| |
| fun = typecheck.Callee(ir.NewSelectorExpr(method.Pos(), ir.OXDOT, recv, method.Sel)) |
| } else { |
| if recv.Type().IsInterface() { |
| // N.B., this happens currently for typeparam/issue51521.go |
| // and typeparam/typeswitch3.go. |
| if base.Flag.LowerM != 0 { |
| base.WarnfAt(method.Pos(), "imprecise interface call") |
| } |
| } |
| |
| fun = method |
| args.Append(recv) |
| } |
| if dictPtr != nil { |
| args.Append(dictPtr) |
| } |
| } else if r.Bool() { // call to instanced function |
| pos := r.pos() |
| _, shapedFn, dictPtr := r.funcInst(pos) |
| fun = shapedFn |
| args.Append(dictPtr) |
| } else { |
| fun = r.expr() |
| } |
| pos := r.pos() |
| args.Append(r.multiExpr()...) |
| dots := r.Bool() |
| n := typecheck.Call(pos, fun, args, dots) |
| switch n.Op() { |
| case ir.OAPPEND: |
| n := n.(*ir.CallExpr) |
| n.RType = r.rtype(pos) |
| // For append(a, b...), we don't need the implicit conversion. The typechecker already |
| // ensured that a and b are both slices with the same base type, or []byte and string. |
| if n.IsDDD { |
| if conv, ok := n.Args[1].(*ir.ConvExpr); ok && conv.Op() == ir.OCONVNOP && conv.Implicit() { |
| n.Args[1] = conv.X |
| } |
| } |
| case ir.OCOPY: |
| n := n.(*ir.BinaryExpr) |
| n.RType = r.rtype(pos) |
| case ir.ODELETE: |
| n := n.(*ir.CallExpr) |
| n.RType = r.rtype(pos) |
| case ir.OUNSAFESLICE: |
| n := n.(*ir.BinaryExpr) |
| n.RType = r.rtype(pos) |
| } |
| return n |
| |
| case exprMake: |
| pos := r.pos() |
| typ := r.exprType() |
| extra := r.exprs() |
| n := typecheck.Expr(ir.NewCallExpr(pos, ir.OMAKE, nil, append([]ir.Node{typ}, extra...))).(*ir.MakeExpr) |
| n.RType = r.rtype(pos) |
| return n |
| |
| case exprNew: |
| pos := r.pos() |
| typ := r.exprType() |
| return typecheck.Expr(ir.NewUnaryExpr(pos, ir.ONEW, typ)) |
| |
| case exprReshape: |
| typ := r.typ() |
| x := r.expr() |
| |
| if types.IdenticalStrict(x.Type(), typ) { |
| return x |
| } |
| |
| // Comparison expressions are constructed as "untyped bool" still. |
| // |
| // TODO(mdempsky): It should be safe to reshape them here too, but |
| // maybe it's better to construct them with the proper type |
| // instead. |
| if x.Type() == types.UntypedBool && typ.IsBoolean() { |
| return x |
| } |
| |
| base.AssertfAt(x.Type().HasShape() || typ.HasShape(), x.Pos(), "%L and %v are not shape types", x, typ) |
| base.AssertfAt(types.Identical(x.Type(), typ), x.Pos(), "%L is not shape-identical to %v", x, typ) |
| |
| // We use ir.HasUniquePos here as a check that x only appears once |
| // in the AST, so it's okay for us to call SetType without |
| // breaking any other uses of it. |
| // |
| // Notably, any ONAMEs should already have the exactly right shape |
| // type and been caught by types.IdenticalStrict above. |
| base.AssertfAt(ir.HasUniquePos(x), x.Pos(), "cannot call SetType(%v) on %L", typ, x) |
| |
| if base.Debug.Reshape != 0 { |
| base.WarnfAt(x.Pos(), "reshaping %L to %v", x, typ) |
| } |
| |
| x.SetType(typ) |
| return x |
| |
| case exprConvert: |
| implicit := r.Bool() |
| typ := r.typ() |
| pos := r.pos() |
| typeWord, srcRType := r.convRTTI(pos) |
| dstTypeParam := r.Bool() |
| identical := r.Bool() |
| x := r.expr() |
| |
| // TODO(mdempsky): Stop constructing expressions of untyped type. |
| x = typecheck.DefaultLit(x, typ) |
| |
| ce := ir.NewConvExpr(pos, ir.OCONV, typ, x) |
| ce.TypeWord, ce.SrcRType = typeWord, srcRType |
| if implicit { |
| ce.SetImplicit(true) |
| } |
| n := typecheck.Expr(ce) |
| |
| // Conversions between non-identical, non-empty interfaces always |
| // requires a runtime call, even if they have identical underlying |
| // interfaces. This is because we create separate itab instances |
| // for each unique interface type, not merely each unique |
| // interface shape. |
| // |
| // However, due to shape types, typecheck.Expr might mistakenly |
| // think a conversion between two non-empty interfaces are |
| // identical and set ir.OCONVNOP, instead of ir.OCONVIFACE. To |
| // ensure we update the itab field appropriately, we force it to |
| // ir.OCONVIFACE instead when shape types are involved. |
| // |
| // TODO(mdempsky): Are there other places we might get this wrong? |
| // Should this be moved down into typecheck.{Assign,Convert}op? |
| // This would be a non-issue if itabs were unique for each |
| // *underlying* interface type instead. |
| if !identical { |
| if n, ok := n.(*ir.ConvExpr); ok && n.Op() == ir.OCONVNOP && n.Type().IsInterface() && !n.Type().IsEmptyInterface() && (n.Type().HasShape() || n.X.Type().HasShape()) { |
| n.SetOp(ir.OCONVIFACE) |
| } |
| } |
| |
| // spec: "If the type is a type parameter, the constant is converted |
| // into a non-constant value of the type parameter." |
| if dstTypeParam && ir.IsConstNode(n) { |
| // Wrap in an OCONVNOP node to ensure result is non-constant. |
| n = Implicit(ir.NewConvExpr(pos, ir.OCONVNOP, n.Type(), n)) |
| n.SetTypecheck(1) |
| } |
| return n |
| } |
| } |
| |
| // funcInst reads an instantiated function reference, and returns |
| // three (possibly nil) expressions related to it: |
| // |
| // baseFn is always non-nil: it's either a function of the appropriate |
| // type already, or it has an extra dictionary parameter as the first |
| // parameter. |
| // |
| // If dictPtr is non-nil, then it's a dictionary argument that must be |
| // passed as the first argument to baseFn. |
| // |
| // If wrapperFn is non-nil, then it's either the same as baseFn (if |
| // dictPtr is nil), or it's semantically equivalent to currying baseFn |
| // to pass dictPtr. (wrapperFn is nil when dictPtr is an expression |
| // that needs to be computed dynamically.) |
| // |
| // For callers that are creating a call to the returned function, it's |
| // best to emit a call to baseFn, and include dictPtr in the arguments |
| // list as appropriate. |
| // |
| // For callers that want to return the function without invoking it, |
| // they may return wrapperFn if it's non-nil; but otherwise, they need |
| // to create their own wrapper. |
| func (r *reader) funcInst(pos src.XPos) (wrapperFn, baseFn, dictPtr ir.Node) { |
| // Like in methodExpr, I'm pretty sure this isn't needed. |
| var implicits []*types.Type |
| if r.dict != nil { |
| implicits = r.dict.targs |
| } |
| |
| if r.Bool() { // dynamic subdictionary |
| idx := r.Len() |
| info := r.dict.subdicts[idx] |
| explicits := r.p.typListIdx(info.explicits, r.dict) |
| |
| baseFn = r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) |
| |
| // TODO(mdempsky): Is there a more robust way to get the |
| // dictionary pointer type here? |
| dictPtrType := baseFn.Type().Params().Field(0).Type |
| dictPtr = typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, dictPtrType, r.dictWord(pos, r.dict.subdictsOffset()+idx))) |
| |
| return |
| } |
| |
| info := r.objInfo() |
| explicits := r.p.typListIdx(info.explicits, r.dict) |
| |
| wrapperFn = r.p.objIdx(info.idx, implicits, explicits, false).(*ir.Name) |
| baseFn = r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) |
| |
| dictName := r.p.objDictName(info.idx, implicits, explicits) |
| dictPtr = typecheck.Expr(ir.NewAddrExpr(pos, dictName)) |
| |
| return |
| } |
| |
| func (pr *pkgReader) objDictName(idx pkgbits.Index, implicits, explicits []*types.Type) *ir.Name { |
| rname := pr.newReader(pkgbits.RelocName, idx, pkgbits.SyncObject1) |
| _, sym := rname.qualifiedIdent() |
| tag := pkgbits.CodeObj(rname.Code(pkgbits.SyncCodeObj)) |
| |
| if tag == pkgbits.ObjStub { |
| assert(!sym.IsBlank()) |
| if pri, ok := objReader[sym]; ok { |
| return pri.pr.objDictName(pri.idx, nil, explicits) |
| } |
| base.Fatalf("unresolved stub: %v", sym) |
| } |
| |
| dict := pr.objDictIdx(sym, idx, implicits, explicits, false) |
| |
| return pr.dictNameOf(dict) |
| } |
| |
| // curry returns a function literal that calls fun with arg0 and |
| // (optionally) arg1, accepting additional arguments to the function |
| // literal as necessary to satisfy fun's signature. |
| // |
| // If nilCheck is true and arg0 is an interface value, then it's |
| // checked to be non-nil as an initial step at the point of evaluating |
| // the function literal itself. |
| func (r *reader) curry(origPos src.XPos, ifaceHack bool, fun ir.Node, arg0, arg1 ir.Node) ir.Node { |
| var captured ir.Nodes |
| captured.Append(fun, arg0) |
| if arg1 != nil { |
| captured.Append(arg1) |
| } |
| |
| params, results := syntheticSig(fun.Type()) |
| params = params[len(captured)-1:] // skip curried parameters |
| typ := types.NewSignature(nil, params, results) |
| |
| addBody := func(pos src.XPos, r *reader, captured []ir.Node) { |
| recvs, params := r.syntheticArgs(pos) |
| assert(len(recvs) == 0) |
| |
| fun := captured[0] |
| |
| var args ir.Nodes |
| args.Append(captured[1:]...) |
| args.Append(params...) |
| |
| r.syntheticTailCall(pos, fun, args) |
| } |
| |
| return r.syntheticClosure(origPos, typ, ifaceHack, captured, addBody) |
| } |
| |
| // methodExprWrap returns a function literal that changes method's |
| // first parameter's type to recv, and uses implicits/deref/addr to |
| // select the appropriate receiver parameter to pass to method. |
| func (r *reader) methodExprWrap(origPos src.XPos, recv *types.Type, implicits []int, deref, addr bool, method, dictPtr ir.Node) ir.Node { |
| var captured ir.Nodes |
| captured.Append(method) |
| |
| params, results := syntheticSig(method.Type()) |
| |
| // Change first parameter to recv. |
| params[0].Type = recv |
| |
| // If we have a dictionary pointer argument to pass, then omit the |
| // underlying method expression's dictionary parameter from the |
| // returned signature too. |
| if dictPtr != nil { |
| captured.Append(dictPtr) |
| params = append(params[:1], params[2:]...) |
| } |
| |
| typ := types.NewSignature(nil, params, results) |
| |
| addBody := func(pos src.XPos, r *reader, captured []ir.Node) { |
| recvs, args := r.syntheticArgs(pos) |
| assert(len(recvs) == 0) |
| |
| fn := captured[0] |
| |
| // Rewrite first argument based on implicits/deref/addr. |
| { |
| arg := args[0] |
| for _, ix := range implicits { |
| arg = Implicit(DotField(pos, arg, ix)) |
| } |
| if deref { |
| arg = Implicit(Deref(pos, arg.Type().Elem(), arg)) |
| } else if addr { |
| arg = Implicit(Addr(pos, arg)) |
| } |
| args[0] = arg |
| } |
| |
| // Insert dictionary argument, if provided. |
| if dictPtr != nil { |
| newArgs := make([]ir.Node, len(args)+1) |
| newArgs[0] = args[0] |
| newArgs[1] = captured[1] |
| copy(newArgs[2:], args[1:]) |
| args = newArgs |
| } |
| |
| r.syntheticTailCall(pos, fn, args) |
| } |
| |
| return r.syntheticClosure(origPos, typ, false, captured, addBody) |
| } |
| |
| // syntheticClosure constructs a synthetic function literal for |
| // currying dictionary arguments. origPos is the position used for the |
| // closure, which must be a non-inlined position. typ is the function |
| // literal's signature type. |
| // |
| // captures is a list of expressions that need to be evaluated at the |
| // point of function literal evaluation and captured by the function |
| // literal. If ifaceHack is true and captures[1] is an interface type, |
| // it's checked to be non-nil after evaluation. |
| // |
| // addBody is a callback function to populate the function body. The |
| // list of captured values passed back has the captured variables for |
| // use within the function literal, corresponding to the expressions |
| // in captures. |
| func (r *reader) syntheticClosure(origPos src.XPos, typ *types.Type, ifaceHack bool, captures ir.Nodes, addBody func(pos src.XPos, r *reader, captured []ir.Node)) ir.Node { |
| // isSafe reports whether n is an expression that we can safely |
| // defer to evaluating inside the closure instead, to avoid storing |
| // them into the closure. |
| // |
| // In practice this is always (and only) the wrappee function. |
| isSafe := func(n ir.Node) bool { |
| if n.Op() == ir.ONAME && n.(*ir.Name).Class == ir.PFUNC { |
| return true |
| } |
| if n.Op() == ir.OMETHEXPR { |
| return true |
| } |
| |
| return false |
| } |
| |
| // The ODCLFUNC and its body need to use the original position, but |
| // the OCLOSURE node and any Init statements should use the inlined |
| // position instead. See also the explanation in reader.funcLit. |
| inlPos := r.inlPos(origPos) |
| |
| fn := ir.NewClosureFunc(origPos, r.curfn != nil) |
| fn.SetWrapper(true) |
| clo := fn.OClosure |
| clo.SetPos(inlPos) |
| ir.NameClosure(clo, r.curfn) |
| |
| setType(fn.Nname, typ) |
| typecheck.Func(fn) |
| setType(clo, fn.Type()) |
| |
| var init ir.Nodes |
| for i, n := range captures { |
| if isSafe(n) { |
| continue // skip capture; can reference directly |
| } |
| |
| tmp := r.tempCopy(inlPos, n, &init) |
| ir.NewClosureVar(origPos, fn, tmp) |
| |
| // We need to nil check interface receivers at the point of method |
| // value evaluation, ugh. |
| if ifaceHack && i == 1 && n.Type().IsInterface() { |
| check := ir.NewUnaryExpr(inlPos, ir.OCHECKNIL, ir.NewUnaryExpr(inlPos, ir.OITAB, tmp)) |
| init.Append(typecheck.Stmt(check)) |
| } |
| } |
| |
| pri := pkgReaderIndex{synthetic: func(pos src.XPos, r *reader) { |
| captured := make([]ir.Node, len(captures)) |
| next := 0 |
| for i, n := range captures { |
| if isSafe(n) { |
| captured[i] = n |
| } else { |
| captured[i] = r.closureVars[next] |
| next++ |
| } |
| } |
| assert(next == len(r.closureVars)) |
| |
| addBody(origPos, r, captured) |
| }} |
| bodyReader[fn] = pri |
| pri.funcBody(fn) |
| |
| // TODO(mdempsky): Remove hard-coding of typecheck.Target. |
| return ir.InitExpr(init, ir.UseClosure(clo, typecheck.Target)) |
| } |
| |
| // syntheticSig duplicates and returns the params and results lists |
| // for sig, but renaming anonymous parameters so they can be assigned |
| // ir.Names. |
| func syntheticSig(sig *types.Type) (params, results []*types.Field) { |
| clone := func(params []*types.Field) []*types.Field { |
| res := make([]*types.Field, len(params)) |
| for i, param := range params { |
| sym := param.Sym |
| if sym == nil || sym.Name == "_" { |
| sym = typecheck.LookupNum(".anon", i) |
| } |
| // TODO(mdempsky): It would be nice to preserve the original |
| // parameter positions here instead, but at least |
| // typecheck.NewMethodType replaces them with base.Pos, making |
| // them useless. Worse, the positions copied from base.Pos may |
| // have inlining contexts, which we definitely don't want here |
| // (e.g., #54625). |
| res[i] = types.NewField(base.AutogeneratedPos, sym, param.Type) |
| res[i].SetIsDDD(param.IsDDD()) |
| } |
| return res |
| } |
| |
| return clone(sig.Params().FieldSlice()), clone(sig.Results().FieldSlice()) |
| } |
| |
| func (r *reader) optExpr() ir.Node { |
| if r.Bool() { |
| return r.expr() |
| } |
| return nil |
| } |
| |
| // methodExpr reads a method expression reference, and returns three |
| // (possibly nil) expressions related to it: |
| // |
| // baseFn is always non-nil: it's either a function of the appropriate |
| // type already, or it has an extra dictionary parameter as the second |
| // parameter (i.e., immediately after the promoted receiver |
| // parameter). |
| // |
| // If dictPtr is non-nil, then it's a dictionary argument that must be |
| // passed as the second argument to baseFn. |
| // |
| // If wrapperFn is non-nil, then it's either the same as baseFn (if |
| // dictPtr is nil), or it's semantically equivalent to currying baseFn |
| // to pass dictPtr. (wrapperFn is nil when dictPtr is an expression |
| // that needs to be computed dynamically.) |
| // |
| // For callers that are creating a call to the returned method, it's |
| // best to emit a call to baseFn, and include dictPtr in the arguments |
| // list as appropriate. |
| // |
| // For callers that want to return a method expression without |
| // invoking it, they may return wrapperFn if it's non-nil; but |
| // otherwise, they need to create their own wrapper. |
| func (r *reader) methodExpr() (wrapperFn, baseFn, dictPtr ir.Node) { |
| recv := r.typ() |
| sig0 := r.typ() |
| pos := r.pos() |
| _, sym := r.selector() |
| |
| // Signature type to return (i.e., recv prepended to the method's |
| // normal parameters list). |
| sig := typecheck.NewMethodType(sig0, recv) |
| |
| if r.Bool() { // type parameter method expression |
| idx := r.Len() |
| word := r.dictWord(pos, r.dict.typeParamMethodExprsOffset()+idx) |
| |
| // TODO(mdempsky): If the type parameter was instantiated with an |
| // interface type (i.e., embed.IsInterface()), then we could |
| // return the OMETHEXPR instead and save an indirection. |
| |
| // We wrote the method expression's entry point PC into the |
| // dictionary, but for Go `func` values we need to return a |
| // closure (i.e., pointer to a structure with the PC as the first |
| // field). Because method expressions don't have any closure |
| // variables, we pun the dictionary entry as the closure struct. |
| fn := typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, sig, ir.NewAddrExpr(pos, word))) |
| return fn, fn, nil |
| } |
| |
| // TODO(mdempsky): I'm pretty sure this isn't needed: implicits is |
| // only relevant to locally defined types, but they can't have |
| // (non-promoted) methods. |
| var implicits []*types.Type |
| if r.dict != nil { |
| implicits = r.dict.targs |
| } |
| |
| if r.Bool() { // dynamic subdictionary |
| idx := r.Len() |
| info := r.dict.subdicts[idx] |
| explicits := r.p.typListIdx(info.explicits, r.dict) |
| |
| shapedObj := r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) |
| shapedFn := shapedMethodExpr(pos, shapedObj, sym) |
| |
| // TODO(mdempsky): Is there a more robust way to get the |
| // dictionary pointer type here? |
| dictPtrType := shapedFn.Type().Params().Field(1).Type |
| dictPtr := typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, dictPtrType, r.dictWord(pos, r.dict.subdictsOffset()+idx))) |
| |
| return nil, shapedFn, dictPtr |
| } |
| |
| if r.Bool() { // static dictionary |
| info := r.objInfo() |
| explicits := r.p.typListIdx(info.explicits, r.dict) |
| |
| shapedObj := r.p.objIdx(info.idx, implicits, explicits, true).(*ir.Name) |
| shapedFn := shapedMethodExpr(pos, shapedObj, sym) |
| |
| dict := r.p.objDictName(info.idx, implicits, explicits) |
| dictPtr := typecheck.Expr(ir.NewAddrExpr(pos, dict)) |
| |
| // Check that dictPtr matches shapedFn's dictionary parameter. |
| if !types.Identical(dictPtr.Type(), shapedFn.Type().Params().Field(1).Type) { |
| base.FatalfAt(pos, "dict %L, but shaped method %L", dict, shapedFn) |
| } |
| |
| // For statically known instantiations, we can take advantage of |
| // the stenciled wrapper. |
| base.AssertfAt(!recv.HasShape(), pos, "shaped receiver %v", recv) |
| wrapperFn := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) |
| base.AssertfAt(types.Identical(sig, wrapperFn.Type()), pos, "wrapper %L does not have type %v", wrapperFn, sig) |
| |
| return wrapperFn, shapedFn, dictPtr |
| } |
| |
| // Simple method expression; no dictionary needed. |
| base.AssertfAt(!recv.HasShape() || recv.IsInterface(), pos, "shaped receiver %v", recv) |
| fn := typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) |
| return fn, fn, nil |
| } |
| |
| // shapedMethodExpr returns the specified method on the given shaped |
| // type. |
| func shapedMethodExpr(pos src.XPos, obj *ir.Name, sym *types.Sym) *ir.SelectorExpr { |
| assert(obj.Op() == ir.OTYPE) |
| |
| typ := obj.Type() |
| assert(typ.HasShape()) |
| |
| method := func() *types.Field { |
| for _, method := range typ.Methods().Slice() { |
| if method.Sym == sym { |
| return method |
| } |
| } |
| |
| base.FatalfAt(pos, "failed to find method %v in shaped type %v", sym, typ) |
| panic("unreachable") |
| }() |
| |
| // Construct an OMETHEXPR node. |
| recv := method.Type.Recv().Type |
| return typecheck.Expr(ir.NewSelectorExpr(pos, ir.OXDOT, ir.TypeNode(recv), sym)).(*ir.SelectorExpr) |
| } |
| |
| func (r *reader) multiExpr() []ir.Node { |
| r.Sync(pkgbits.SyncMultiExpr) |
| |
| if r.Bool() { // N:1 |
| pos := r.pos() |
| expr := r.expr() |
| |
| results := make([]ir.Node, r.Len()) |
| as := ir.NewAssignListStmt(pos, ir.OAS2, nil, []ir.Node{expr}) |
| as.Def = true |
| for i := range results { |
| tmp := r.temp(pos, r.typ()) |
| as.PtrInit().Append(ir.NewDecl(pos, ir.ODCL, tmp)) |
| as.Lhs.Append(tmp) |
| |
| res := ir.Node(tmp) |
| if r.Bool() { |
| n := ir.NewConvExpr(pos, ir.OCONV, r.typ(), res) |
| n.TypeWord, n.SrcRType = r.convRTTI(pos) |
| n.SetImplicit(true) |
| res = typecheck.Expr(n) |
| } |
| results[i] = res |
| } |
| |
| // TODO(mdempsky): Could use ir.InlinedCallExpr instead? |
| results[0] = ir.InitExpr([]ir.Node{typecheck.Stmt(as)}, results[0]) |
| return results |
| } |
| |
| // N:N |
| exprs := make([]ir.Node, r.Len()) |
| if len(exprs) == 0 { |
| return nil |
| } |
| for i := range exprs { |
| exprs[i] = r.expr() |
| } |
| return exprs |
| } |
| |
| // temp returns a new autotemp of the specified type. |
| func (r *reader) temp(pos src.XPos, typ *types.Type) *ir.Name { |
| // See typecheck.typecheckargs. |
| curfn := r.curfn |
| if curfn == nil { |
| curfn = typecheck.InitTodoFunc |
| } |
| |
| return typecheck.TempAt(pos, curfn, typ) |
| } |
| |
| // tempCopy declares and returns a new autotemp initialized to the |
| // value of expr. |
| func (r *reader) tempCopy(pos src.XPos, expr ir.Node, init *ir.Nodes) *ir.Name { |
| if r.curfn == nil { |
| // Escape analysis doesn't know how to handle package-scope |
| // function literals with free variables (i.e., that capture |
| // temporary variables added to typecheck.InitTodoFunc). |
| // |
| // stencil.go works around this limitation by spilling values to |
| // global variables instead, but that causes the value to stay |
| // alive indefinitely; see go.dev/issue/54343. |
| // |
| // This code path (which implements the same workaround) isn't |
| // actually needed by unified IR, because it creates uses normal |
| // OMETHEXPR/OMETHVALUE nodes when statically-known instantiated |
| // types are used. But it's kept around for now because it's handy |
| // for testing that the generic fallback paths work correctly. |
| base.Fatalf("tempCopy called at package scope") |
| |
| tmp := staticinit.StaticName(expr.Type()) |
| |
| assign := ir.NewAssignStmt(pos, tmp, expr) |
| assign.Def = true |
| tmp.Defn = assign |
| |
| typecheck.Target.Decls = append(typecheck.Target.Decls, typecheck.Stmt(assign)) |
| |
| return tmp |
| } |
| |
| tmp := r.temp(pos, expr.Type()) |
| |
| init.Append(typecheck.Stmt(ir.NewDecl(pos, ir.ODCL, tmp))) |
| |
| assign := ir.NewAssignStmt(pos, tmp, expr) |
| assign.Def = true |
| init.Append(typecheck.Stmt(ir.NewAssignStmt(pos, tmp, expr))) |
| |
| tmp.Defn = assign |
| |
| return tmp |
| } |
| |
| func (r *reader) compLit() ir.Node { |
| r.Sync(pkgbits.SyncCompLit) |
| pos := r.pos() |
| typ0 := r.typ() |
| |
| typ := typ0 |
| if typ.IsPtr() { |
| typ = typ.Elem() |
| } |
| if typ.Kind() == types.TFORW { |
| base.FatalfAt(pos, "unresolved composite literal type: %v", typ) |
| } |
| var rtype ir.Node |
| if typ.IsMap() { |
| rtype = r.rtype(pos) |
| } |
| isStruct := typ.Kind() == types.TSTRUCT |
| |
| elems := make([]ir.Node, r.Len()) |
| for i := range elems { |
| elemp := &elems[i] |
| |
| if isStruct { |
| sk := ir.NewStructKeyExpr(r.pos(), typ.Field(r.Len()), nil) |
| *elemp, elemp = sk, &sk.Value |
| } else if r.Bool() { |
| kv := ir.NewKeyExpr(r.pos(), r.expr(), nil) |
| *elemp, elemp = kv, &kv.Value |
| } |
| |
| *elemp = wrapName(r.pos(), r.expr()) |
| } |
| |
| lit := typecheck.Expr(ir.NewCompLitExpr(pos, ir.OCOMPLIT, typ, elems)) |
| if rtype != nil { |
| lit := lit.(*ir.CompLitExpr) |
| lit.RType = rtype |
| } |
| if typ0.IsPtr() { |
| lit = typecheck.Expr(typecheck.NodAddrAt(pos, lit)) |
| lit.SetType(typ0) |
| } |
| return lit |
| } |
| |
| func wrapName(pos src.XPos, x ir.Node) ir.Node { |
| // These nodes do not carry line numbers. |
| // Introduce a wrapper node to give them the correct line. |
| switch ir.Orig(x).Op() { |
| case ir.OTYPE, ir.OLITERAL: |
| if x.Sym() == nil { |
| break |
| } |
| fallthrough |
| case ir.ONAME, ir.ONONAME, ir.ONIL: |
| p := ir.NewParenExpr(pos, x) |
| p.SetImplicit(true) |
| return p |
| } |
| return x |
| } |
| |
| func (r *reader) funcLit() ir.Node { |
| r.Sync(pkgbits.SyncFuncLit) |
| |
| // The underlying function declaration (including its parameters' |
| // positions, if any) need to remain the original, uninlined |
| // positions. This is because we track inlining-context on nodes so |
| // we can synthesize the extra implied stack frames dynamically when |
| // generating tracebacks, whereas those stack frames don't make |
| // sense *within* the function literal. (Any necessary inlining |
| // adjustments will have been applied to the call expression |
| // instead.) |
| // |
| // This is subtle, and getting it wrong leads to cycles in the |
| // inlining tree, which lead to infinite loops during stack |
| // unwinding (#46234, #54625). |
| // |
| // Note that we *do* want the inline-adjusted position for the |
| // OCLOSURE node, because that position represents where any heap |
| // allocation of the closure is credited (#49171). |
| r.suppressInlPos++ |
| pos := r.pos() |
| xtype2 := r.signature(nil) |
| r.suppressInlPos-- |
| |
| fn := ir.NewClosureFunc(pos, r.curfn != nil) |
| clo := fn.OClosure |
| clo.SetPos(r.inlPos(pos)) // see comment above |
| ir.NameClosure(clo, r.curfn) |
| |
| setType(fn.Nname, xtype2) |
| typecheck.Func(fn) |
| setType(clo, fn.Type()) |
| |
| fn.ClosureVars = make([]*ir.Name, 0, r.Len()) |
| for len(fn.ClosureVars) < cap(fn.ClosureVars) { |
| ir.NewClosureVar(r.pos(), fn, r.useLocal()) |
| } |
| if param := r.dictParam; param != nil { |
| // If we have a dictionary parameter, capture it too. For |
| // simplicity, we capture it last and unconditionally. |
| ir.NewClosureVar(param.Pos(), fn, param) |
| } |
| |
| r.addBody(fn, nil) |
| |
| // TODO(mdempsky): Remove hard-coding of typecheck.Target. |
| return ir.UseClosure(clo, typecheck.Target) |
| } |
| |
| func (r *reader) exprList() []ir.Node { |
| r.Sync(pkgbits.SyncExprList) |
| return r.exprs() |
| } |
| |
| func (r *reader) exprs() []ir.Node { |
| r.Sync(pkgbits.SyncExprs) |
| nodes := make([]ir.Node, r.Len()) |
| if len(nodes) == 0 { |
| return nil // TODO(mdempsky): Unclear if this matters. |
| } |
| for i := range nodes { |
| nodes[i] = r.expr() |
| } |
| return nodes |
| } |
| |
| // dictWord returns an expression to return the specified |
| // uintptr-typed word from the dictionary parameter. |
| func (r *reader) dictWord(pos src.XPos, idx int) ir.Node { |
| base.AssertfAt(r.dictParam != nil, pos, "expected dictParam in %v", r.curfn) |
| return typecheck.Expr(ir.NewIndexExpr(pos, r.dictParam, ir.NewBasicLit(pos, constant.MakeInt64(int64(idx))))) |
| } |
| |
| // rttiWord is like dictWord, but converts it to *byte (the type used |
| // internally to represent *runtime._type and *runtime.itab). |
| func (r *reader) rttiWord(pos src.XPos, idx int) ir.Node { |
| return typecheck.Expr(ir.NewConvExpr(pos, ir.OCONVNOP, types.NewPtr(types.Types[types.TUINT8]), r.dictWord(pos, idx))) |
| } |
| |
| // rtype reads a type reference from the element bitstream, and |
| // returns an expression of type *runtime._type representing that |
| // type. |
| func (r *reader) rtype(pos src.XPos) ir.Node { |
| _, rtype := r.rtype0(pos) |
| return rtype |
| } |
| |
| func (r *reader) rtype0(pos src.XPos) (typ *types.Type, rtype ir.Node) { |
| r.Sync(pkgbits.SyncRType) |
| if r.Bool() { // derived type |
| idx := r.Len() |
| info := r.dict.rtypes[idx] |
| typ = r.p.typIdx(info, r.dict, true) |
| rtype = r.rttiWord(pos, r.dict.rtypesOffset()+idx) |
| return |
| } |
| |
| typ = r.typ() |
| rtype = reflectdata.TypePtrAt(pos, typ) |
| return |
| } |
| |
| // varDictIndex populates name.DictIndex if name is a derived type. |
| func (r *reader) varDictIndex(name *ir.Name) { |
| if r.Bool() { |
| idx := 1 + r.dict.rtypesOffset() + r.Len() |
| if int(uint16(idx)) != idx { |
| base.FatalfAt(name.Pos(), "DictIndex overflow for %v: %v", name, idx) |
| } |
| name.DictIndex = uint16(idx) |
| } |
| } |
| |
| // itab returns a (typ, iface) pair of types. |
| // |
| // typRType and ifaceRType are expressions that evaluate to the |
| // *runtime._type for typ and iface, respectively. |
| // |
| // If typ is a concrete type and iface is a non-empty interface type, |
| // then itab is an expression that evaluates to the *runtime.itab for |
| // the pair. Otherwise, itab is nil. |
| func (r *reader) itab(pos src.XPos) (typ *types.Type, typRType ir.Node, iface *types.Type, ifaceRType ir.Node, itab ir.Node) { |
| typ, typRType = r.rtype0(pos) |
| iface, ifaceRType = r.rtype0(pos) |
| |
| idx := -1 |
| if r.Bool() { |
| idx = r.Len() |
| } |
| |
| if !typ.IsInterface() && iface.IsInterface() && !iface.IsEmptyInterface() { |
| if idx >= 0 { |
| itab = r.rttiWord(pos, r.dict.itabsOffset()+idx) |
| } else { |
| base.AssertfAt(!typ.HasShape(), pos, "%v is a shape type", typ) |
| base.AssertfAt(!iface.HasShape(), pos, "%v is a shape type", iface) |
| |
| lsym := reflectdata.ITabLsym(typ, iface) |
| itab = typecheck.LinksymAddr(pos, lsym, types.Types[types.TUINT8]) |
| } |
| } |
| |
| return |
| } |
| |
| // convRTTI returns expressions appropriate for populating an |
| // ir.ConvExpr's TypeWord and SrcRType fields, respectively. |
| func (r *reader) convRTTI(pos src.XPos) (typeWord, srcRType ir.Node) { |
| r.Sync(pkgbits.SyncConvRTTI) |
| src, srcRType0, dst, dstRType, itab := r.itab(pos) |
| if !dst.IsInterface() { |
| return |
| } |
| |
| // See reflectdata.ConvIfaceTypeWord. |
| switch { |
| case dst.IsEmptyInterface(): |
| if !src.IsInterface() { |
| typeWord = srcRType0 // direct eface construction |
| } |
| case !src.IsInterface(): |
| typeWord = itab // direct iface construction |
| default: |
| typeWord = dstRType // convI2I |
| } |
| |
| // See reflectdata.ConvIfaceSrcRType. |
| if !src.IsInterface() { |
| srcRType = srcRType0 |
| } |
| |
| return |
| } |
| |
| func (r *reader) exprType() ir.Node { |
| r.Sync(pkgbits.SyncExprType) |
| pos := r.pos() |
| |
| var typ *types.Type |
| var rtype, itab ir.Node |
| |
| if r.Bool() { |
| typ, rtype, _, _, itab = r.itab(pos) |
| if !typ.IsInterface() { |
| rtype = nil // TODO(mdempsky): Leave set? |
| } |
| } else { |
| typ, rtype = r.rtype0(pos) |
| |
| if !r.Bool() { // not derived |
| // TODO(mdempsky): ir.TypeNode should probably return a typecheck'd node. |
| n := ir.TypeNode(typ) |
| n.SetTypecheck(1) |
| return n |
| } |
| } |
| |
| dt := ir.NewDynamicType(pos, rtype) |
| dt.ITab = itab |
| return typed(typ, dt) |
| } |
| |
| func (r *reader) op() ir.Op { |
| r.Sync(pkgbits.SyncOp) |
| return ir.Op(r.Len()) |
| } |
| |
| // @@@ Package initialization |
| |
| func (r *reader) pkgInit(self *types.Pkg, target *ir.Package) { |
| cgoPragmas := make([][]string, r.Len()) |
| for i := range cgoPragmas { |
| cgoPragmas[i] = r.Strings() |
| } |
| target.CgoPragmas = cgoPragmas |
| |
| r.pkgDecls(target) |
| |
| r.Sync(pkgbits.SyncEOF) |
| } |
| |
| func (r *reader) pkgDecls(target *ir.Package) { |
| r.Sync(pkgbits.SyncDecls) |
| for { |
| switch code := codeDecl(r.Code(pkgbits.SyncDecl)); code { |
| default: |
| panic(fmt.Sprintf("unhandled decl: %v", code)) |
| |
| case declEnd: |
| return |
| |
| case declFunc: |
| names := r.pkgObjs(target) |
| assert(len(names) == 1) |
| target.Decls = append(target.Decls, names[0].Func) |
| |
| case declMethod: |
| typ := r.typ() |
| _, sym := r.selector() |
| |
| method := typecheck.Lookdot1(nil, sym, typ, typ.Methods(), 0) |
| target.Decls = append(target.Decls, method.Nname.(*ir.Name).Func) |
| |
| case declVar: |
| pos := r.pos() |
| names := r.pkgObjs(target) |
| values := r.exprList() |
| |
| if len(names) > 1 && len(values) == 1 { |
| as := ir.NewAssignListStmt(pos, ir.OAS2, nil, values) |
| for _, name := range names { |
| as.Lhs.Append(name) |
| name.Defn = as |
| } |
| target.Decls = append(target.Decls, as) |
| } else { |
| for i, name := range names { |
| as := ir.NewAssignStmt(pos, name, nil) |
| if i < len(values) { |
| as.Y = values[i] |
| } |
| name.Defn = as |
| target.Decls = append(target.Decls, as) |
| } |
| } |
| |
| if n := r.Len(); n > 0 { |
| assert(len(names) == 1) |
| embeds := make([]ir.Embed, n) |
| for i := range embeds { |
| embeds[i] = ir.Embed{Pos: r.pos(), Patterns: r.Strings()} |
| } |
| names[0].Embed = &embeds |
| target.Embeds = append(target.Embeds, names[0]) |
| } |
| |
| case declOther: |
| r.pkgObjs(target) |
| } |
| } |
| } |
| |
| func (r *reader) pkgObjs(target *ir.Package) []*ir.Name { |
| r.Sync(pkgbits.SyncDeclNames) |
| nodes := make([]*ir.Name, r.Len()) |
| for i := range nodes { |
| r.Sync(pkgbits.SyncDeclName) |
| |
| name := r.obj().(*ir.Name) |
| nodes[i] = name |
| |
| sym := name.Sym() |
| if sym.IsBlank() { |
| continue |
| } |
| |
| switch name.Class { |
| default: |
| base.FatalfAt(name.Pos(), "unexpected class: %v", name.Class) |
| |
| case ir.PEXTERN: |
| target.Externs = append(target.Externs, name) |
| |
| case ir.PFUNC: |
| assert(name.Type().Recv() == nil) |
| |
| // TODO(mdempsky): Cleaner way to recognize init? |
| if strings.HasPrefix(sym.Name, "init.") { |
| target.Inits = append(target.Inits, name.Func) |
| } |
| } |
| |
| if types.IsExported(sym.Name) { |
| assert(!sym.OnExportList()) |
| target.Exports = append(target.Exports, name) |
| sym.SetOnExportList(true) |
| } |
| |
| if base.Flag.AsmHdr != "" { |
| assert(!sym.Asm()) |
| target.Asms = append(target.Asms, name) |
| sym.SetAsm(true) |
| } |
| } |
| |
| return nodes |
| } |
| |
| // @@@ Inlining |
| |
| // unifiedHaveInlineBody reports whether we have the function body for |
| // fn, so we can inline it. |
| func unifiedHaveInlineBody(fn *ir.Func) bool { |
| if fn.Inl == nil { |
| return false |
| } |
| |
| _, ok := bodyReaderFor(fn) |
| return ok |
| } |
| |
| var inlgen = 0 |
| |
| // unifiedInlineCall implements inline.NewInline by re-reading the function |
| // body from its Unified IR export data. |
| func unifiedInlineCall(call *ir.CallExpr, fn *ir.Func, inlIndex int) *ir.InlinedCallExpr { |
| // TODO(mdempsky): Turn callerfn into an explicit parameter. |
| callerfn := ir.CurFunc |
| |
| pri, ok := bodyReaderFor(fn) |
| if !ok { |
| base.FatalfAt(call.Pos(), "cannot inline call to %v: missing inline body", fn) |
| } |
| |
| if fn.Inl.Body == nil { |
| expandInline(fn, pri) |
| } |
| |
| r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) |
| |
| // TODO(mdempsky): This still feels clumsy. Can we do better? |
| tmpfn := ir.NewFunc(fn.Pos()) |
| tmpfn.Nname = ir.NewNameAt(fn.Nname.Pos(), callerfn.Sym()) |
| tmpfn.Closgen = callerfn.Closgen |
| defer func() { callerfn.Closgen = tmpfn.Closgen }() |
| |
| setType(tmpfn.Nname, fn.Type()) |
| r.curfn = tmpfn |
| |
| r.inlCaller = callerfn |
| r.inlCall = call |
| r.inlFunc = fn |
| r.inlTreeIndex = inlIndex |
| r.inlPosBases = make(map[*src.PosBase]*src.PosBase) |
| |
| r.closureVars = make([]*ir.Name, len(r.inlFunc.ClosureVars)) |
| for i, cv := range r.inlFunc.ClosureVars { |
| r.closureVars[i] = cv.Outer |
| } |
| if len(r.closureVars) != 0 && r.hasTypeParams() { |
| r.dictParam = r.closureVars[len(r.closureVars)-1] // dictParam is last; see reader.funcLit |
| } |
| |
| r.funcargs(fn) |
| |
| r.delayResults = fn.Inl.CanDelayResults |
| |
| r.retlabel = typecheck.AutoLabel(".i") |
| inlgen++ |
| |
| init := ir.TakeInit(call) |
| |
| // For normal function calls, the function callee expression |
| // may contain side effects. Make sure to preserve these, |
| // if necessary (#42703). |
| if call.Op() == ir.OCALLFUNC { |
| inline.CalleeEffects(&init, call.X) |
| } |
| |
| var args ir.Nodes |
| if call.Op() == ir.OCALLMETH { |
| base.FatalfAt(call.Pos(), "OCALLMETH missed by typecheck") |
| } |
| args.Append(call.Args...) |
| |
| // Create assignment to declare and initialize inlvars. |
| as2 := ir.NewAssignListStmt(call.Pos(), ir.OAS2, r.inlvars, args) |
| as2.Def = true |
| var as2init ir.Nodes |
| for _, name := range r.inlvars { |
| if ir.IsBlank(name) { |
| continue |
| } |
| // TODO(mdempsky): Use inlined position of name.Pos() instead? |
| name := name.(*ir.Name) |
| as2init.Append(ir.NewDecl(call.Pos(), ir.ODCL, name)) |
| name.Defn = as2 |
| } |
| as2.SetInit(as2init) |
| init.Append(typecheck.Stmt(as2)) |
| |
| if !r.delayResults { |
| // If not delaying retvars, declare and zero initialize the |
| // result variables now. |
| for _, name := range r.retvars { |
| // TODO(mdempsky): Use inlined position of name.Pos() instead? |
| name := name.(*ir.Name) |
| init.Append(ir.NewDecl(call.Pos(), ir.ODCL, name)) |
| ras := ir.NewAssignStmt(call.Pos(), name, nil) |
| init.Append(typecheck.Stmt(ras)) |
| } |
| } |
| |
| // Add an inline mark just before the inlined body. |
| // This mark is inline in the code so that it's a reasonable spot |
| // to put a breakpoint. Not sure if that's really necessary or not |
| // (in which case it could go at the end of the function instead). |
| // Note issue 28603. |
| init.Append(ir.NewInlineMarkStmt(call.Pos().WithIsStmt(), int64(r.inlTreeIndex))) |
| |
| nparams := len(r.curfn.Dcl) |
| |
| ir.WithFunc(r.curfn, func() { |
| if !r.syntheticBody(call.Pos()) { |
| assert(r.Bool()) // have body |
| |
| r.curfn.Body = r.stmts() |
| r.curfn.Endlineno = r.pos() |
| } |
| |
| // TODO(mdempsky): This shouldn't be necessary. Inlining might |
| // read in new function/method declarations, which could |
| // potentially be recursively inlined themselves; but we shouldn't |
| // need to read in the non-inlined bodies for the declarations |
| // themselves. But currently it's an easy fix to #50552. |
| readBodies(typecheck.Target, true) |
| |
| deadcode.Func(r.curfn) |
| |
| // Replace any "return" statements within the function body. |
| var edit func(ir.Node) ir.Node |
| edit = func(n ir.Node) ir.Node { |
| if ret, ok := n.(*ir.ReturnStmt); ok { |
| n = typecheck.Stmt(r.inlReturn(ret)) |
| } |
| ir.EditChildren(n, edit) |
| return n |
| } |
| edit(r.curfn) |
| }) |
| |
| body := ir.Nodes(r.curfn.Body) |
| |
| // Quirkish: We need to eagerly prune variables added during |
| // inlining, but removed by deadcode.FuncBody above. Unused |
| // variables will get removed during stack frame layout anyway, but |
| // len(fn.Dcl) ends up influencing things like autotmp naming. |
| |
| used := usedLocals(body) |
| |
| for i, name := range r.curfn.Dcl { |
| if i < nparams || used.Has(name) { |
| name.Curfn = callerfn |
| callerfn.Dcl = append(callerfn.Dcl, name) |
| |
| if name.AutoTemp() { |
| name.SetEsc(ir.EscUnknown) |
| name.SetInlLocal(true) |
| } |
| } |
| } |
| |
| body.Append(ir.NewLabelStmt(call.Pos(), r.retlabel)) |
| |
| res := ir.NewInlinedCallExpr(call.Pos(), body, append([]ir.Node(nil), r.retvars...)) |
| res.SetInit(init) |
| res.SetType(call.Type()) |
| res.SetTypecheck(1) |
| |
| // Inlining shouldn't add any functions to todoBodies. |
| assert(len(todoBodies) == 0) |
| |
| return res |
| } |
| |
| // inlReturn returns a statement that can substitute for the given |
| // return statement when inlining. |
| func (r *reader) inlReturn(ret *ir.ReturnStmt) *ir.BlockStmt { |
| pos := r.inlCall.Pos() |
| |
| block := ir.TakeInit(ret) |
| |
| if results := ret.Results; len(results) != 0 { |
| assert(len(r.retvars) == len(results)) |
| |
| as2 := ir.NewAssignListStmt(pos, ir.OAS2, append([]ir.Node(nil), r.retvars...), ret.Results) |
| |
| if r.delayResults { |
| for _, name := range r.retvars { |
| // TODO(mdempsky): Use inlined position of name.Pos() instead? |
| name := name.(*ir.Name) |
| block.Append(ir.NewDecl(pos, ir.ODCL, name)) |
| name.Defn = as2 |
| } |
| } |
| |
| block.Append(as2) |
| } |
| |
| block.Append(ir.NewBranchStmt(pos, ir.OGOTO, r.retlabel)) |
| return ir.NewBlockStmt(pos, block) |
| } |
| |
| // expandInline reads in an extra copy of IR to populate |
| // fn.Inl.{Dcl,Body}. |
| func expandInline(fn *ir.Func, pri pkgReaderIndex) { |
| // TODO(mdempsky): Remove this function. It's currently needed by |
| // dwarfgen/dwarf.go:preInliningDcls, which requires fn.Inl.Dcl to |
| // create abstract function DIEs. But we should be able to provide it |
| // with the same information some other way. |
| |
| fndcls := len(fn.Dcl) |
| topdcls := len(typecheck.Target.Decls) |
| |
| tmpfn := ir.NewFunc(fn.Pos()) |
| tmpfn.Nname = ir.NewNameAt(fn.Nname.Pos(), fn.Sym()) |
| tmpfn.ClosureVars = fn.ClosureVars |
| |
| { |
| r := pri.asReader(pkgbits.RelocBody, pkgbits.SyncFuncBody) |
| setType(tmpfn.Nname, fn.Type()) |
| |
| // Don't change parameter's Sym/Nname fields. |
| r.funarghack = true |
| |
| r.funcBody(tmpfn) |
| |
| ir.WithFunc(tmpfn, func() { |
| deadcode.Func(tmpfn) |
| }) |
| } |
| |
| used := usedLocals(tmpfn.Body) |
| |
| for _, name := range tmpfn.Dcl { |
| if name.Class != ir.PAUTO || used.Has(name) { |
| name.Curfn = fn |
| fn.Inl.Dcl = append(fn.Inl.Dcl, name) |
| } |
| } |
| fn.Inl.Body = tmpfn.Body |
| |
| // Double check that we didn't change fn.Dcl by accident. |
| assert(fndcls == len(fn.Dcl)) |
| |
| // typecheck.Stmts may have added function literals to |
| // typecheck.Target.Decls. Remove them again so we don't risk trying |
| // to compile them multiple times. |
| typecheck.Target.Decls = typecheck.Target.Decls[:topdcls] |
| } |
| |
| // usedLocals returns a set of local variables that are used within body. |
| func usedLocals(body []ir.Node) ir.NameSet { |
| var used ir.NameSet |
| ir.VisitList(body, func(n ir.Node) { |
| if n, ok := n.(*ir.Name); ok && n.Op() == ir.ONAME && n.Class == ir.PAUTO { |
| used.Add(n) |
| } |
| }) |
| return used |
| } |
| |
| // @@@ Method wrappers |
| |
| // needWrapperTypes lists types for which we may need to generate |
| // method wrappers. |
| var needWrapperTypes []*types.Type |
| |
| // haveWrapperTypes lists types for which we know we already have |
| // method wrappers, because we found the type in an imported package. |
| var haveWrapperTypes []*types.Type |
| |
| // needMethodValueWrappers lists methods for which we may need to |
| // generate method value wrappers. |
| var needMethodValueWrappers []methodValueWrapper |
| |
| // haveMethodValueWrappers lists methods for which we know we already |
| // have method value wrappers, because we found it in an imported |
| // package. |
| var haveMethodValueWrappers []methodValueWrapper |
| |
| type methodValueWrapper struct { |
| rcvr *types.Type |
| method *types.Field |
| } |
| |
| func (r *reader) needWrapper(typ *types.Type) { |
| if typ.IsPtr() { |
| return |
| } |
| |
| // If a type was found in an imported package, then we can assume |
| // that package (or one of its transitive dependencies) already |
| // generated method wrappers for it. |
| if r.importedDef() { |
| haveWrapperTypes = append(haveWrapperTypes, typ) |
| } else { |
| needWrapperTypes = append(needWrapperTypes, typ) |
| } |
| } |
| |
| // importedDef reports whether r is reading from an imported and |
| // non-generic element. |
| // |
| // If a type was found in an imported package, then we can assume that |
| // package (or one of its transitive dependencies) already generated |
| // method wrappers for it. |
| // |
| // Exception: If we're instantiating an imported generic type or |
| // function, we might be instantiating it with type arguments not |
| // previously seen before. |
| // |
| // TODO(mdempsky): Distinguish when a generic function or type was |
| // instantiated in an imported package so that we can add types to |
| // haveWrapperTypes instead. |
| func (r *reader) importedDef() bool { |
| return r.p != localPkgReader && !r.hasTypeParams() |
| } |
| |
| func MakeWrappers(target *ir.Package) { |
| // always generate a wrapper for error.Error (#29304) |
| needWrapperTypes = append(needWrapperTypes, types.ErrorType) |
| |
| seen := make(map[string]*types.Type) |
| |
| for _, typ := range haveWrapperTypes { |
| wrapType(typ, target, seen, false) |
| } |
| haveWrapperTypes = nil |
| |
| for _, typ := range needWrapperTypes { |
| wrapType(typ, target, seen, true) |
| } |
| needWrapperTypes = nil |
| |
| for _, wrapper := range haveMethodValueWrappers { |
| wrapMethodValue(wrapper.rcvr, wrapper.method, target, false) |
| } |
| haveMethodValueWrappers = nil |
| |
| for _, wrapper := range needMethodValueWrappers { |
| wrapMethodValue(wrapper.rcvr, wrapper.method, target, true) |
| } |
| needMethodValueWrappers = nil |
| } |
| |
| func wrapType(typ *types.Type, target *ir.Package, seen map[string]*types.Type, needed bool) { |
| key := typ.LinkString() |
| if prev := seen[key]; prev != nil { |
| if !types.Identical(typ, prev) { |
| base.Fatalf("collision: types %v and %v have link string %q", typ, prev, key) |
| } |
| return |
| } |
| seen[key] = typ |
| |
| if !needed { |
| // Only called to add to 'seen'. |
| return |
| } |
| |
| if !typ.IsInterface() { |
| typecheck.CalcMethods(typ) |
| } |
| for _, meth := range typ.AllMethods().Slice() { |
| if meth.Sym.IsBlank() || !meth.IsMethod() { |
| base.FatalfAt(meth.Pos, "invalid method: %v", meth) |
| } |
| |
| methodWrapper(0, typ, meth, target) |
| |
| // For non-interface types, we also want *T wrappers. |
| if !typ.IsInterface() { |
| methodWrapper(1, typ, meth, target) |
| |
| // For not-in-heap types, *T is a scalar, not pointer shaped, |
| // so the interface wrappers use **T. |
| if typ.NotInHeap() { |
| methodWrapper(2, typ, meth, target) |
| } |
| } |
| } |
| } |
| |
| func methodWrapper(derefs int, tbase *types.Type, method *types.Field, target *ir.Package) { |
| wrapper := tbase |
| for i := 0; i < derefs; i++ { |
| wrapper = types.NewPtr(wrapper) |
| } |
| |
| sym := ir.MethodSym(wrapper, method.Sym) |
| base.Assertf(!sym.Siggen(), "already generated wrapper %v", sym) |
| sym.SetSiggen(true) |
| |
| wrappee := method.Type.Recv().Type |
| if types.Identical(wrapper, wrappee) || |
| !types.IsMethodApplicable(wrapper, method) || |
| !reflectdata.NeedEmit(tbase) { |
| return |
| } |
| |
| // TODO(mdempsky): Use method.Pos instead? |
| pos := base.AutogeneratedPos |
| |
| fn := newWrapperFunc(pos, sym, wrapper, method) |
| |
| var recv ir.Node = fn.Nname.Type().Recv().Nname.(*ir.Name) |
| |
| // For simple *T wrappers around T methods, panicwrap produces a |
| // nicer panic message. |
| if wrapper.IsPtr() && types.Identical(wrapper.Elem(), wrappee) { |
| cond := ir.NewBinaryExpr(pos, ir.OEQ, recv, types.BuiltinPkg.Lookup("nil").Def.(ir.Node)) |
| then := []ir.Node{ir.NewCallExpr(pos, ir.OCALL, typecheck.LookupRuntime("panicwrap"), nil)} |
| fn.Body.Append(ir.NewIfStmt(pos, cond, then, nil)) |
| } |
| |
| // typecheck will add one implicit deref, if necessary, |
| // but not-in-heap types require more for their **T wrappers. |
| for i := 1; i < derefs; i++ { |
| recv = Implicit(ir.NewStarExpr(pos, recv)) |
| } |
| |
| addTailCall(pos, fn, recv, method) |
| |
| finishWrapperFunc(fn, target) |
| } |
| |
| func wrapMethodValue(recvType *types.Type, method *types.Field, target *ir.Package, needed bool) { |
| sym := ir.MethodSymSuffix(recvType, method.Sym, "-fm") |
| if sym.Uniq() { |
| return |
| } |
| sym.SetUniq(true) |
| |
| // TODO(mdempsky): Use method.Pos instead? |
| pos := base.AutogeneratedPos |
| |
| fn := newWrapperFunc(pos, sym, nil, method) |
| sym.Def = fn.Nname |
| |
| // Declare and initialize variable holding receiver. |
| recv := ir.NewHiddenParam(pos, fn, typecheck.Lookup(".this"), recvType) |
| |
| if !needed { |
| typecheck.Func(fn) |
| return |
| } |
| |
| addTailCall(pos, fn, recv, method) |
| |
| finishWrapperFunc(fn, target) |
| } |
| |
| func newWrapperFunc(pos src.XPos, sym *types.Sym, wrapper *types.Type, method *types.Field) *ir.Func { |
| fn := ir.NewFunc(pos) |
| fn.SetDupok(true) // TODO(mdempsky): Leave unset for local, non-generic wrappers? |
| |
| name := ir.NewNameAt(pos, sym) |
| ir.MarkFunc(name) |
| name.Func = fn |
| name.Defn = fn |
| fn.Nname = name |
| |
| sig := newWrapperType(wrapper, method) |
| setType(name, sig) |
| |
| // TODO(mdempsky): De-duplicate with similar logic in funcargs. |
| defParams := func(class ir.Class, params *types.Type) { |
| for _, param := range params.FieldSlice() { |
| name := ir.NewNameAt(param.Pos, param.Sym) |
| name.Class = class |
| setType(name, param.Type) |
| |
| name.Curfn = fn |
| fn.Dcl = append(fn.Dcl, name) |
| |
| param.Nname = name |
| } |
| } |
| |
| defParams(ir.PPARAM, sig.Recvs()) |
| defParams(ir.PPARAM, sig.Params()) |
| defParams(ir.PPARAMOUT, sig.Results()) |
| |
| return fn |
| } |
| |
| func finishWrapperFunc(fn *ir.Func, target *ir.Package) { |
| typecheck.Func(fn) |
| |
| ir.WithFunc(fn, func() { |
| typecheck.Stmts(fn.Body) |
| }) |
| |
| // We generate wrappers after the global inlining pass, |
| // so we're responsible for applying inlining ourselves here. |
| // TODO(prattmic): plumb PGO. |
| inline.InlineCalls(fn, nil) |
| |
| // The body of wrapper function after inlining may reveal new ir.OMETHVALUE node, |
| // we don't know whether wrapper function has been generated for it or not, so |
| // generate one immediately here. |
| // |
| // Further, after CL 492017, function that construct closures is allowed to be inlined, |
| // even though the closure itself can't be inline. So we also need to visit body of any |
| // closure that we see when visiting body of the wrapper function. |
| ir.VisitFuncAndClosures(fn, func(n ir.Node) { |
| if n, ok := n.(*ir.SelectorExpr); ok && n.Op() == ir.OMETHVALUE { |
| wrapMethodValue(n.X.Type(), n.Selection, target, true) |
| } |
| }) |
| |
| target.Decls = append(target.Decls, fn) |
| } |
| |
| // newWrapperType returns a copy of the given signature type, but with |
| // the receiver parameter type substituted with recvType. |
| // If recvType is nil, newWrapperType returns a signature |
| // without a receiver parameter. |
| func newWrapperType(recvType *types.Type, method *types.Field) *types.Type { |
| clone := func(params []*types.Field) []*types.Field { |
| res := make([]*types.Field, len(params)) |
| for i, param := range params { |
| sym := param.Sym |
| if sym == nil || sym.Name == "_" { |
| sym = typecheck.LookupNum(".anon", i) |
| } |
| res[i] = types.NewField(param.Pos, sym, param.Type) |
| res[i].SetIsDDD(param.IsDDD()) |
| } |
| return res |
| } |
| |
| sig := method.Type |
| |
| var recv *types.Field |
| if recvType != nil { |
| recv = types.NewField(sig.Recv().Pos, typecheck.Lookup(".this"), recvType) |
| } |
| params := clone(sig.Params().FieldSlice()) |
| results := clone(sig.Results().FieldSlice()) |
| |
| return types.NewSignature(recv, params, results) |
| } |
| |
| func addTailCall(pos src.XPos, fn *ir.Func, recv ir.Node, method *types.Field) { |
| sig := fn.Nname.Type() |
| args := make([]ir.Node, sig.NumParams()) |
| for i, param := range sig.Params().FieldSlice() { |
| args[i] = param.Nname.(*ir.Name) |
| } |
| |
| // TODO(mdempsky): Support creating OTAILCALL, when possible. See reflectdata.methodWrapper. |
| // Not urgent though, because tail calls are currently incompatible with regabi anyway. |
| |
| fn.SetWrapper(true) // TODO(mdempsky): Leave unset for tail calls? |
| |
| dot := ir.NewSelectorExpr(pos, ir.OXDOT, recv, method.Sym) |
| call := typecheck.Call(pos, dot, args, method.Type.IsVariadic()).(*ir.CallExpr) |
| |
| if method.Type.NumResults() == 0 { |
| fn.Body.Append(call) |
| return |
| } |
| |
| ret := ir.NewReturnStmt(pos, nil) |
| ret.Results = []ir.Node{call} |
| fn.Body.Append(ret) |
| } |
| |
| func setBasePos(pos src.XPos) { |
| // Set the position for any error messages we might print (e.g. too large types). |
| base.Pos = pos |
| } |
| |
| // dictParamName is the name of the synthetic dictionary parameter |
| // added to shaped functions. |
| // |
| // N.B., this variable name is known to Delve: |
| // https://github.com/go-delve/delve/blob/cb91509630529e6055be845688fd21eb89ae8714/pkg/proc/eval.go#L28 |
| const dictParamName = typecheck.LocalDictName |
| |
| // shapeSig returns a copy of fn's signature, except adding a |
| // dictionary parameter and promoting the receiver parameter (if any) |
| // to a normal parameter. |
| // |
| // The parameter types.Fields are all copied too, so their Nname |
| // fields can be initialized for use by the shape function. |
| func shapeSig(fn *ir.Func, dict *readerDict) *types.Type { |
| sig := fn.Nname.Type() |
| oldRecv := sig.Recv() |
| |
| var recv *types.Field |
| if oldRecv != nil { |
| recv = types.NewField(oldRecv.Pos, oldRecv.Sym, oldRecv.Type) |
| } |
| |
| params := make([]*types.Field, 1+sig.Params().Fields().Len()) |
| params[0] = types.NewField(fn.Pos(), fn.Sym().Pkg.Lookup(dictParamName), types.NewPtr(dict.varType())) |
| for i, param := range sig.Params().Fields().Slice() { |
| d := types.NewField(param.Pos, param.Sym, param.Type) |
| d.SetIsDDD(param.IsDDD()) |
| params[1+i] = d |
| } |
| |
| results := make([]*types.Field, sig.Results().Fields().Len()) |
| for i, result := range sig.Results().Fields().Slice() { |
| results[i] = types.NewField(result.Pos, result.Sym, result.Type) |
| } |
| |
| return types.NewSignature(recv, params, results) |
| } |